Jump to:
loading...| Preferred Name |
rifampicin |
|
| Synonyms |
|
|
| Definitions |
A member of the class of rifamycins that is a a semisynthetic antibiotic derived from Amycolatopsis rifamycinica (previously known as Amycolatopsis mediterranei and Streptomyces mediterranei) |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28077 |
|
| database_cross_reference |
DrugBank:DB01045 CASRN:13292-46-1 Wikipedia:Rifampicin |
|
| definition |
A member of the class of rifamycins that is a a semisynthetic antibiotic derived from Amycolatopsis rifamycinica (previously known as Amycolatopsis mediterranei and Streptomyces mediterranei) |
|
| label |
rifampicin |
|
| prefixIRI |
CHEBI:28077 |
|
| prefLabel |
rifampicin |
|
| smiles |
CO[C@H]1\C=C\O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C)c(\C=N\N1CCN(C)CC1)c(O)c4c3C2=O |
|
| subClassOf |
Create mapping