Jump to:
loading...| Preferred Name | lithocholic acid | |
| Synonyms |
|
|
| Definitions |
A monohydroxy-5β-cholanic acid with aα-hydroxy substituent at position 3. It is a bile acid obtained from chenodeoxycholic acid by bacterial action. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16325 |
|
| definition |
A monohydroxy-5β-cholanic acid with aα-hydroxy substituent at position 3. It is a bile acid obtained from chenodeoxycholic acid by bacterial action. |
|
| formula |
C24H40O3 |
|
| label |
lithocholic acid |
|
| prefixIRI |
CHEBI:16325 |
|
| prefLabel |
lithocholic acid |
|
| smiles |
[H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@]([H])(CC[C@@]34[H])[C@H](C)CCC(O)=O)[C@@]1(C)CC[C@@H](O)C2 |
|
| subClassOf |
Create mapping