Preferred Name |
orlistat |
|
Synonyms |
(2S)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]tridecan-2-yl N-formyl-L-leucinate (-)-tetrahydrolipostatin N-formyl-L-leucine (1S)-1-{[(2S,3S)-3-hexyl-4-oxo-2-oxetanyl]methyl}dodecyl ester (2S)-2-formamido-4-methylpentanoic acid [(2S)-1-[(2S,3S)-3-hexyl-4-oxo-2-oxetanyl]tridecan-2-yl] ester Alli Ro-18-0647 Xenical orlipastat orlistat orlistatum |
|
Definitions |
A carboxylic ester resulting from the formal condensation of the carboxy group of N-formyl-L-leucine with the hydroxy group of (3S,4S)-3-hexyl-4-[(2S)-2-hydroxytridecyl]oxetan-2-one. A pancreatic lipase inhibitor, it is used as an anti-obesity drug. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_94686 |
|
charge |
0 |
|
database_cross_reference |
PMID:28387458 PMID:28624425 Reaxys:3658031 PMID:28260907 PMID:28559211 Patent:EP129748 CAS:96829-58-2 PMID:27793869 Drug_Central:1996 Patent:US4598089 PMID:28097013 LINCS:LSM-5724 PMID:28588183 PMID:28191026 Wikipedia:Orlistat KEGG:D04028 |
|
formula |
C29H53NO5 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_71476 http://purl.obolibrary.org/obo/CHEBI_65001 |
|
has_exact_synonym |
(2S)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]tridecan-2-yl N-formyl-L-leucinate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(-)-tetrahydrolipostatin N-formyl-L-leucine (1S)-1-{[(2S,3S)-3-hexyl-4-oxo-2-oxetanyl]methyl}dodecyl ester (2S)-2-formamido-4-methylpentanoic acid [(2S)-1-[(2S,3S)-3-hexyl-4-oxo-2-oxetanyl]tridecan-2-yl] ester Alli Ro-18-0647 Xenical orlipastat orlistat orlistatum |
|
has_RxCUI |
37925 |
|
id |
CHEBI:94686 |
|
in_subset | ||
inchi |
InChI=1S/C29H53NO5/c1-5-7-9-11-12-13-14-15-16-18-24(34-29(33)26(30-22-31)20-23(3)4)21-27-25(28(32)35-27)19-17-10-8-6-2/h22-27H,5-21H2,1-4H3,(H,30,31)/t24-,25-,26-,27-/m0/s1 |
|
inchikey |
AHLBNYSZXLDEJQ-FWEHEUNISA-N |
|
label |
orlistat |
|
mass |
495.736 |
|
monoisotopicmass |
495.39237 |
|
notation |
CHEBI:94686 |
|
prefixIRI |
CHEBI:94686 |
|
prefLabel |
orlistat |
|
smiles |
[C@@]1(OC([C@]1(CCCCCC)[H])=O)(C[C@H](CCCCCCCCCCC)OC([C@@H](NC(=O)[H])CC(C)C)=O)[H] |
|
textual definition |
A carboxylic ester resulting from the formal condensation of the carboxy group of N-formyl-L-leucine with the hydroxy group of (3S,4S)-3-hexyl-4-[(2S)-2-hydroxytridecyl]oxetan-2-one. A pancreatic lipase inhibitor, it is used as an anti-obesity drug. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_25018 http://purl.obolibrary.org/obo/CHEBI_33308 |