Preferred Name |
Procainamide |
|
Synonyms |
4-amino-N-[2-(diethylamino)ethyl]benzamide Procainamide p-Aminobenzoic diethylaminoethylamide p-Amino-N-(2-diethylaminoethyl)benzamide procainamida procainamide procainamidum Biocoryl |
|
Definitions |
A benzamide that is 4-aminobenzamide substituted on the amide N by a 2-(diethylamino)ethyl group. It is a pharmaceutical antiarrhythmic agent used for the medical treatment of cardiac arrhythmias. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8428 |
|
charge |
0 |
|
database_cross_reference |
PMID:29494946 DrugBank:DB01035 PMID:29276243 Beilstein:2214285 PMID:2494958 KEGG:C07401 PMID:16230360 CAS:51-06-9 KEGG:D08421 Wikipedia:Procainamide Drug_Central:2270 LINCS:LSM-3681 Reaxys:2214285 |
|
formula |
C13H21N3O |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_38070 |
|
has_exact_synonym |
4-amino-N-[2-(diethylamino)ethyl]benzamide Procainamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
p-Aminobenzoic diethylaminoethylamide p-Amino-N-(2-diethylaminoethyl)benzamide procainamida procainamide procainamidum Biocoryl |
|
has_RxCUI |
8700 |
|
id |
CHEBI:8428 |
|
in_subset | ||
inchi |
InChI=1S/C13H21N3O/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17) |
|
inchikey |
REQCZEXYDRLIBE-UHFFFAOYSA-N |
|
label |
procainamide Procainamide |
|
mass |
235.32546 |
|
monoisotopicmass |
235.16846 |
|
notation |
CHEBI:8428 |
|
prefixIRI |
CHEBI:8428 |
|
prefLabel |
Procainamide |
|
smiles |
CCN(CC)CCNC(=O)c1ccc(N)cc1 |
|
textual definition |
A benzamide that is 4-aminobenzamide substituted on the amide N by a 2-(diethylamino)ethyl group. It is a pharmaceutical antiarrhythmic agent used for the medical treatment of cardiac arrhythmias. |
|
subClassOf |