Preferred Name |
Probenecid |
|
Synonyms |
4-(dipropylsulfamoyl)benzoic acid probenecidum 4-(N,N-Dipropylsulfamoyl)benzoesaeure probenecide probenecida p-(Dipropylsulfamoyl)benzoic acid Probenecid Acid 4-((Dipropylamino)sulfonyl)benzoic acid 4-(Di-n-propylsulfamoyl)benzoesaeure probenecid |
|
Definitions |
A sulfonamide in which the nitrogen of 4-sulfamoylbenzoic acid is substituted with two propyl groups. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8426 |
|
charge |
0 |
|
database_cross_reference |
PMID:509935 PMID:21861129 PMID:22561103 KEGG:D00475 LINCS:LSM-4140 Reaxys:2815775 Beilstein:2815775 CAS:57-66-9 Wikipedia:Probenecid PMID:23129053 PMID:22681402 PMID:22854641 PMID:22582566 Drug_Central:2268 Patent:US2608507 PMID:22321288 KEGG:C07372 DrugBank:DB01032 PMID:21938493 |
|
formula |
C13H19NO4S |
|
has role | ||
has_exact_synonym |
4-(dipropylsulfamoyl)benzoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
probenecidum 4-(N,N-Dipropylsulfamoyl)benzoesaeure probenecide probenecida p-(Dipropylsulfamoyl)benzoic acid Probenecid Acid 4-((Dipropylamino)sulfonyl)benzoic acid 4-(Di-n-propylsulfamoyl)benzoesaeure probenecid |
|
has_RxCUI |
8698 |
|
id |
CHEBI:8426 |
|
in_subset | ||
inchi |
InChI=1S/C13H19NO4S/c1-3-9-14(10-4-2)19(17,18)12-7-5-11(6-8-12)13(15)16/h5-8H,3-4,9-10H2,1-2H3,(H,15,16) |
|
inchikey |
DBABZHXKTCFAPX-UHFFFAOYSA-N |
|
is bearer of | ||
label |
probenecid Probenecid |
|
mass |
285.35900 |
|
monoisotopicmass |
285.10348 |
|
notation |
CHEBI:8426 |
|
prefixIRI |
CHEBI:8426 |
|
prefLabel |
Probenecid |
|
smiles |
CCCN(CCC)S(=O)(=O)c1ccc(cc1)C(O)=O |
|
textual definition |
A sulfonamide in which the nitrogen of 4-sulfamoylbenzoic acid is substituted with two propyl groups. |
|
subClassOf |