loading...| Preferred Name |
pramocaine |
|
| Synonyms |
4-[3-(4-butoxyphenoxy)propyl]morpholine Pramocaine pramocainum p-butoxyphenyl gamma-morpholinopropyl ether gamma-morpholinopropyl 4-n-butoxyphenyl ether proxazocain Pramoxine |
|
| Definitions |
A member of the class of morpholines that is morpholine substituted at the nitrogen atom by a 3-(4-butoxyphenoxy)propyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8357 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D08407 Drug_Central:3487 PMID:24819289 PMID:8150879 LINCS:LSM-5573 Beilstein:239059 KEGG:C07892 PMID:17244091 Reaxys:239059 Wikipedia:Pramocaine CAS:140-65-8 |
|
| formula |
C17H27NO3 |
|
| has role | ||
| has_exact_synonym |
4-[3-(4-butoxyphenoxy)propyl]morpholine Pramocaine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
pramocainum p-butoxyphenyl gamma-morpholinopropyl ether gamma-morpholinopropyl 4-n-butoxyphenyl ether proxazocain Pramoxine |
|
| has_RxCUI |
34347 |
|
| id |
CHEBI:8357 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H27NO3/c1-2-3-12-20-16-5-7-17(8-6-16)21-13-4-9-18-10-14-19-15-11-18/h5-8H,2-4,9-15H2,1H3 |
|
| inchikey |
DQKXQSGTHWVTAD-UHFFFAOYSA-N |
|
| label |
pramocaine pramoxine |
|
| mass |
293.40122 |
|
| monoisotopicmass |
293.19909 |
|
| notation |
CHEBI:8357 |
|
| prefixIRI |
CHEBI:8357 |
|
| prefLabel |
pramocaine |
|
| smiles |
CCCCOc1ccc(OCCCN2CCOCC2)cc1 |
|
| textual definition |
A member of the class of morpholines that is morpholine substituted at the nitrogen atom by a 3-(4-butoxyphenoxy)propyl group. |
|
| subClassOf |