loading...| Preferred Name |
Phenformin |
|
| Synonyms |
N-(2-phenylethyl)imidodicarbonimidic diamide phenforminum phenformine DBI fenformina phenformin |
|
| Definitions |
A member of the class of biguanides that is biguanide in which one of the terminal nitrogen atoms is substituted by a 2-phenylethyl group. It was used as an anti-diabetic drug but was later withdrawn from the market due to potential risk of lactic acidosis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8064 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23612073 Drug_Central:2126 Patent:US2961377 PDBeChem:8CV PMID:7390164 CAS:114-86-3 DrugBank:DB00914 PMID:23548904 PMID:18239244 PMID:23475884 PMID:21084729 Wikipedia:Phenformin PMID:28766937 PMID:23322141 PMID:22036620 Patent:US3057780 LINCS:LSM-2233 PMID:20188727 KEGG:D08351 PMID:22361631 PMID:16567854 KEGG:C07673 Patent:WO2010114805 HMDB:HMDB0015050 Reaxys:1977317 |
|
| formula |
C10H15N5 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
| has_exact_synonym |
N-(2-phenylethyl)imidodicarbonimidic diamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
phenforminum phenformine DBI fenformina phenformin |
|
| has_RxCUI |
8129 |
|
| id |
CHEBI:8064 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H15N5/c11-9(12)15-10(13)14-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H6,11,12,13,14,15) |
|
| inchikey |
ICFJFFQQTFMIBG-UHFFFAOYSA-N |
|
| is bearer of | ||
| label |
phenformin Phenformin |
|
| mass |
205.265 |
|
| monoisotopicmass |
205.13275 |
|
| notation |
CHEBI:8064 |
|
| prefixIRI |
CHEBI:8064 |
|
| prefLabel |
Phenformin |
|
| smiles |
NC(=N)NC(=N)NCCC1=CC=CC=C1 |
|
| textual definition |
A member of the class of biguanides that is biguanide in which one of the terminal nitrogen atoms is substituted by a 2-phenylethyl group. It was used as an anti-diabetic drug but was later withdrawn from the market due to potential risk of lactic acidosis. |
|
| subClassOf |