loading...| Preferred Name | carminic acid | |
| Synonyms |
Cochineal tincture Coccinellin C.I. Natural Red 4 Sun Red No. 1 Coccus cacti extract Carmine red Cochineal extract Natural red 4 C.I. 75470 Carmine Cochineal Sanred 1 Sun Red 1 (1S)-1,5-anhydro-1-(7-carboxy-1,3,4,6-tetrahydroxy-8-methyl-9,10-dioxo-9,10-dihydroanthracen-2-yl)-D-glucitol |
|
| Definitions |
A tetrahydroxyanthraquinone that is that is 1,3,4,6-tetrahydroxy-9,10-anthraquinone substituted by a methyl group at position 8, a carboxy group at position 7 and a 1,5-anhydro-D-glucitol moiety at position 2 via a C-glycosidic linkage. It is a natural dye isolated from several insects such as Dactylopius coccus. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_78310 |
|
| alternative term |
Cochineal tincture Coccinellin C.I. Natural Red 4 Sun Red No. 1 Coccus cacti extract Carmine red Cochineal extract Natural red 4 C.I. 75470 Carmine Cochineal Sanred 1 Sun Red 1 (1S)-1,5-anhydro-1-(7-carboxy-1,3,4,6-tetrahydroxy-8-methyl-9,10-dioxo-9,10-dihydroanthracen-2-yl)-D-glucitol |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
KEGG:C11254 Wikipedia:Carminic_acid Reaxys:1414932 PMID:24415463 PMID:24731378 PMID:29551461 PMID:32319483 FooDB:FDB002568 PMID:24733592 CAS:1260-17-9 HMDB:HMDB0030658 |
|
| formula |
C22H20O13 |
|
| has role | ||
| has_alternative_id |
CHEBI:3422 |
|
| has_exact_synonym |
(1S)-1,5-anhydro-1-(7-carboxy-1,3,4,6-tetrahydroxy-8-methyl-9,10-dioxo-9,10-dihydroanthracen-2-yl)-D-glucitol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Cochineal tincture Coccinellin C.I. Natural Red 4 Sun Red No. 1 Coccus cacti extract Carmine red Cochineal extract Natural red 4 C.I. 75470 Carmine Cochineal Sanred 1 Sun Red 1 |
|
| id |
CHEBI:78310 |
|
| in_subset | ||
| inchi |
InChI=1S/C22H20O13/c1-4-8-5(2-6(24)9(4)22(33)34)13(25)10-11(15(8)27)16(28)12(18(30)17(10)29)21-20(32)19(31)14(26)7(3-23)35-21/h2,7,14,19-21,23-24,26,28-32H,3H2,1H3,(H,33,34)/t7-,14-,19+,20-,21+/m1/s1 |
|
| inchikey |
DGQLVPJVXFOQEV-JNVSTXMASA-N |
|
| is conjugate acid of | ||
| label |
carminic acid |
|
| mass |
492.389 |
|
| monoisotopicmass |
492.09039 |
|
| notation |
CHEBI:78310 |
|
| prefLabel |
carminic acid |
|
| smiles |
C=1(C(=C2C(C3=C(C=C(O)C(C(O)=O)=C3C)C(C2=C(O)C1O)=O)=O)O)[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO |
|
| textual definition |
A tetrahydroxyanthraquinone that is that is 1,3,4,6-tetrahydroxy-9,10-anthraquinone substituted by a methyl group at position 8, a carboxy group at position 7 and a 1,5-anhydro-D-glucitol moiety at position 2 via a C-glycosidic linkage. It is a natural dye isolated from several insects such as Dactylopius coccus. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_20857 |