Preferred Name |
armodafinil |
|
Synonyms |
(-)-modafinil (R)-(-)-modafinil armodafinil armodafinilum (R)-modafinil armodafinilo (-)-(R)-modafinil CEP 10953 CEP-10953 Nuvigil 2-[(R)-(diphenylmethyl)sulfinyl]acetamide |
|
Definitions |
A 2-[(diphenylmethyl)sulfinyl]acetamide that has R configuration at the sulfur atom. Like its racemate, modafinil, it is used for the treatment of sleeping disorders such as narcolepsy, obstructive sleep apnoea, and shift-work sleep disorder. Peak concentration in the blood later occurs later following administration than with modafinil, so it is thought that armodafinil may be more effective than modafinil in treating people with excessive daytime sleepiness. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_77590 |
|
alternative term |
(-)-modafinil (R)-(-)-modafinil armodafinil armodafinilum (R)-modafinil armodafinilo (-)-(R)-modafinil CEP 10953 CEP-10953 Nuvigil 2-[(R)-(diphenylmethyl)sulfinyl]acetamide |
|
bearer_of | ||
charge |
0 |
|
database_cross_reference |
PMID:22960434 Reaxys:9767970 PMID:22967783 PMID:22210169 PMID:19663523 Drug_Central:4501 PMID:22803602 PMID:20697340 CAS:112111-43-0 PMID:23251870 PMID:22039290 PMID:21427431 PMID:20816042 PMID:22537794 PMID:24122734 PMID:23983964 PMID:19689169 Wikipedia:Armodafinil PMID:22917711 PMID:22128728 KEGG:D03215 |
|
formula |
C15H15NO2S |
|
has role | ||
has_exact_synonym |
2-[(R)-(diphenylmethyl)sulfinyl]acetamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(-)-modafinil (R)-(-)-modafinil armodafinil armodafinilum (R)-modafinil armodafinilo (-)-(R)-modafinil CEP 10953 CEP-10953 Nuvigil |
|
has_RxCUI |
641465 |
|
id |
CHEBI:77590 |
|
in_subset | ||
inchi |
InChI=1S/C15H15NO2S/c16-14(17)11-19(18)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2,(H2,16,17)/t19-/m1/s1 |
|
inchikey |
YFGHCGITMMYXAQ-LJQANCHMSA-N |
|
is enantiomer of | ||
label |
armodafinil |
|
mass |
273.35000 |
|
monoisotopicmass |
273.08235 |
|
notation |
CHEBI:77590 |
|
prefixIRI |
CHEBI:77590 |
|
prefLabel |
armodafinil |
|
smiles |
NC(=O)C[S@@](=O)C(c1ccccc1)c1ccccc1 |
|
textual definition |
A 2-[(diphenylmethyl)sulfinyl]acetamide that has R configuration at the sulfur atom. Like its racemate, modafinil, it is used for the treatment of sleeping disorders such as narcolepsy, obstructive sleep apnoea, and shift-work sleep disorder. Peak concentration in the blood later occurs later following administration than with modafinil, so it is thought that armodafinil may be more effective than modafinil in treating people with excessive daytime sleepiness. |
|
subClassOf |