loading...| Preferred Name | (+)-menthol | |
| Synonyms |
(+)-(1S,3S,4R)-menthol (1S,2R,5S)-menthol (1S,2R,5S)-(+)-menthol (+)-(1S,2R,5S)-menthol D-menthol d-menthol (1S,2R,5S)-2-isopropyl-5-methylcyclohexanol |
|
| Definitions |
A p-menthan-3-ol which has (1S,2R,5S)-stereochemistry. In contrast to (-)-menthol, the (+)-enantiomer occurs only rarely in nature. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_76306 |
|
| alternative term |
(+)-(1S,3S,4R)-menthol (1S,2R,5S)-menthol (1S,2R,5S)-(+)-menthol (+)-(1S,2R,5S)-menthol D-menthol d-menthol (1S,2R,5S)-2-isopropyl-5-methylcyclohexanol |
|
| charge |
0 |
|
| database_cross_reference |
PMID:18640220 PMID:20932885 CAS:15356-60-2 Reaxys:1902292 |
|
| formula |
C10H20O |
|
| has_exact_synonym |
(1S,2R,5S)-2-isopropyl-5-methylcyclohexanol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(+)-(1S,3S,4R)-menthol (1S,2R,5S)-menthol (1S,2R,5S)-(+)-menthol (+)-(1S,2R,5S)-menthol D-menthol d-menthol |
|
| id |
CHEBI:76306 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m0/s1 |
|
| inchikey |
NOOLISFMXDJSKH-AEJSXWLSSA-N |
|
| is enantiomer of | ||
| label |
(+)-menthol |
|
| mass |
156.26520 |
|
| monoisotopicmass |
156.15142 |
|
| notation |
CHEBI:76306 |
|
| prefLabel |
(+)-menthol |
|
| smiles |
CC(C)[C@H]1CC[C@H](C)C[C@@H]1O |
|
| textual definition |
A p-menthan-3-ol which has (1S,2R,5S)-stereochemistry. In contrast to (-)-menthol, the (+)-enantiomer occurs only rarely in nature. |
|
| subClassOf |