Preferred Name |
octadecanoate ester |
|
Synonyms |
octadecanoate ester alkyl octadecanoate stearic acid ester octadecanoic acid ester stearate ester |
|
Definitions |
A fatty acid ester obtained by condensation of the carboxy group of stearic acid with the hydroxy group of any alcohol or phenol. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_75925 |
|
charge |
0 |
|
formula |
C18H35O2R |
|
has functional parent | ||
has_exact_synonym |
octadecanoate ester |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
alkyl octadecanoate stearic acid ester octadecanoic acid ester stearate ester |
|
id |
CHEBI:75925 |
|
in_subset | ||
label |
octadecanoate ester |
|
mass |
283.470 |
|
monoisotopicmass |
283.26371 |
|
notation |
CHEBI:75925 |
|
prefLabel |
octadecanoate ester |
|
smiles |
C(CCCCCCCCCC)CCCCCCC(=O)O* |
|
textual definition |
A fatty acid ester obtained by condensation of the carboxy group of stearic acid with the hydroxy group of any alcohol or phenol. |
|
subClassOf |
Create mapping