Preferred Name |
naftifine |
|
Synonyms |
(2E)-N-methyl-N-(1-naphthylmethyl)-3-phenylprop-2-en-1-amine (E)-N-cinnamyl-N-methyl-1-naphthalenemethylamine trans-N-cinnamyl-N-methyl-(1-naphthylmethyl)amine naftifin naftifina naftifine naftifinum |
|
Definitions |
A tertiary amine in which the nitrogen is substituted by methyl, alpha-naphthylmethyl, and (1E)-cinnamyl groups. It is used (usually as its hydrochloride salt) for the treatment of fungal skin infections. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7451 |
|
charge |
0 |
|
database_cross_reference |
Patent:US4282251 Drug_Central:1872 PMID:6388170 DrugBank:DB00735 PMID:18212112 Reaxys:2983617 Wikipedia:Naftifine Patent:BE853976 HMDB:HMDB0014873 PMID:25294700 KEGG:C08071 KEGG:D08245 PMID:24196340 CAS:65472-88-0 |
|
formula |
C21H21N |
|
has role | ||
has_exact_synonym |
(2E)-N-methyl-N-(1-naphthylmethyl)-3-phenylprop-2-en-1-amine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(E)-N-cinnamyl-N-methyl-1-naphthalenemethylamine trans-N-cinnamyl-N-methyl-(1-naphthylmethyl)amine naftifin naftifina naftifine naftifinum |
|
has_RxCUI |
31476 |
|
id |
CHEBI:7451 |
|
in_subset | ||
inchi |
InChI=1S/C21H21N/c1-22(16-8-11-18-9-3-2-4-10-18)17-20-14-7-13-19-12-5-6-15-21(19)20/h2-15H,16-17H2,1H3/b11-8+ |
|
inchikey |
OZGNYLLQHRPOBR-DHZHZOJOSA-N |
|
label |
naftifine |
|
mass |
287.39810 |
|
monoisotopicmass |
287.16740 |
|
notation |
CHEBI:7451 |
|
prefixIRI |
CHEBI:7451 |
|
prefLabel |
naftifine |
|
smiles |
CN(C\C=C\c1ccccc1)Cc1cccc2ccccc12 |
|
textual definition |
A tertiary amine in which the nitrogen is substituted by methyl, alpha-naphthylmethyl, and (1E)-cinnamyl groups. It is used (usually as its hydrochloride salt) for the treatment of fungal skin infections. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_32876 |