loading...| Preferred Name |
dienogest |
|
| Synonyms |
[(17beta)-17-hydroxy-3-oxoestra-4,9-dien-17-yl]acetonitrile (17-hydroxy-3-oxoestra-4,9-dien-17beta-yl)acetonitrile dienogestum 17alpha-Cyanomethyl-17beta-hydroxyestra-4,9(10)-dien-3-one dienogest |
|
| Definitions |
A steroid hormone that is 17beta-hydroxy-3-oxoestra-4,9-diene substituted at position 17 by a cyanomethyl group. Used as an oral contraceptive. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_70708 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22876102 PMID:22322156 PMID:22149760 PMID:22264663 Patent:US2008214512 PMID:22169052 Drug_Central:871 PMID:22445438 Reaxys:5763925 PMID:22160205 CAS:65928-58-7 PMID:22366992 PMID:21681516 PMID:23003209 PMID:22459918 Wikipedia:Dienogest PMID:22364708 PMID:22130322 Patent:US6670350 PMID:22571602 PMID:22003899 Patent:WO2011132045 KEGG:D03799 Patent:WO2008116890 PMID:22067805 PMID:22878119 PMID:22515510 PMID:22413833 Patent:EP1935898 Patent:US2010298585 |
|
| formula |
C20H25NO2 |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_59826 |
|
| has_exact_synonym |
[(17beta)-17-hydroxy-3-oxoestra-4,9-dien-17-yl]acetonitrile |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(17-hydroxy-3-oxoestra-4,9-dien-17beta-yl)acetonitrile dienogestum 17alpha-Cyanomethyl-17beta-hydroxyestra-4,9(10)-dien-3-one dienogest |
|
| has_RxCUI |
22968 |
|
| id |
CHEBI:70708 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H25NO2/c1-19-8-6-16-15-5-3-14(22)12-13(15)2-4-17(16)18(19)7-9-20(19,23)10-11-21/h12,17-18,23H,2-10H2,1H3/t17-,18+,19+,20-/m1/s1 |
|
| inchikey |
AZFLJNIPTRTECV-FUMNGEBKSA-N |
|
| label |
dienogest |
|
| mass |
311.41800 |
|
| monoisotopicmass |
311.18853 |
|
| notation |
CHEBI:70708 |
|
| prefixIRI |
CHEBI:70708 |
|
| prefLabel |
dienogest |
|
| smiles |
[H][C@@]12CCC3=CC(=O)CCC3=C1CC[C@@]1(C)[C@@]2([H])CC[C@@]1(O)CC#N |
|
| textual definition |
A steroid hormone that is 17beta-hydroxy-3-oxoestra-4,9-diene substituted at position 17 by a cyanomethyl group. Used as an oral contraceptive. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35343 http://purl.obolibrary.org/obo/CHEBI_80291 |