loading...| Preferred Name | Megestrol | |
| Synonyms |
17-Hydroxy-6-methylpregna-4,6-diene-3,20-dione megestrolum megestrol megestrolo 17-hydroxy-6-methylpregna-4,6-diene-3,20-dione Megestrol |
|
| Definitions |
A 3-oxo Delta(4)-steroid that is pregna-4,6-diene-3,20-dione substituted by a methyl group at position 6 and a hydroxy group at position 17. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6722 |
|
| alternative term |
17-Hydroxy-6-methylpregna-4,6-diene-3,20-dione megestrolum megestrol megestrolo 17-hydroxy-6-methylpregna-4,6-diene-3,20-dione Megestrol |
|
| bearer_of |
http://purl.obolibrary.org/obo/CHEBI_50779 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_59826 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Megestrol PMID:32352735 KEGG:D08167 HMDB:HMDB0014495 Reaxys:3164843 PMID:32652300 DrugBank:DB00351 CAS:3562-63-8 LIPID_MAPS_instance:LMST02030177 PMID:32047089 PMID:32037291 PMID:32644631 Beilstein:3164843 KEGG:C07120 PMID:12161003 |
|
| formula |
C22H30O3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_50779 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_59826 |
|
| has_exact_synonym |
17-hydroxy-6-methylpregna-4,6-diene-3,20-dione Megestrol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
17-Hydroxy-6-methylpregna-4,6-diene-3,20-dione megestrolum megestrol megestrolo |
|
| has_RxCUI |
6703 |
|
| id |
CHEBI:6722 |
|
| in_subset | ||
| inchi |
InChI=1S/C22H30O3/c1-13-11-16-17(20(3)8-5-15(24)12-19(13)20)6-9-21(4)18(16)7-10-22(21,25)14(2)23/h11-12,16-18,25H,5-10H2,1-4H3/t16-,17+,18+,20-,21+,22+/m1/s1 |
|
| inchikey |
VXIMPSPISRVBPZ-NWUMPJBXSA-N |
|
| label |
Megestrol megestrol |
|
| mass |
328.44522 |
|
| monoisotopicmass |
328.20384 |
|
| notation |
CHEBI:6722 |
|
| prefixIRI |
CHEBI:6722 |
|
| prefLabel |
Megestrol |
|
| smiles |
[H][C@@]12CC[C@](O)(C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])C=C(C)C2=CC(=O)CC[C@]12C |
|
| textual definition |
A 3-oxo Delta(4)-steroid that is pregna-4,6-diene-3,20-dione substituted by a methyl group at position 6 and a hydroxy group at position 17. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_139592 http://purl.obolibrary.org/obo/CHEBI_36885 |