Preferred Name |
Loperamide |
|
Synonyms |
4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide Loperamide loperamide loperamidum loperamida |
|
Definitions |
A synthetic piperidine derivative, effective against diarrhoea resulting from gastroenteritis or inflammatory bowel disease. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6532 |
|
charge |
0 |
|
database_cross_reference |
Patent:FR2100711 Patent:US3714159 Beilstein:1558273 KEGG:C07080 KEGG:D08144 PMID:15900907 CAS:53179-11-6 LINCS:LSM-3365 Drug_Central:1599 PMID:24398461 Wikipedia:Loperamide HMDB:HMDB0004999 DrugBank:DB00836 PMID:19034106 Reaxys:1558273 |
|
formula |
C29H33ClN2O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_149553 |
|
has_exact_synonym |
4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide Loperamide loperamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
loperamidum loperamida loperamide |
|
has_RxCUI |
6468 |
|
id |
CHEBI:6532 |
|
in_subset | ||
inchi |
InChI=1S/C29H33ClN2O2/c1-31(2)27(33)29(24-9-5-3-6-10-24,25-11-7-4-8-12-25)19-22-32-20-17-28(34,18-21-32)23-13-15-26(30)16-14-23/h3-16,34H,17-22H2,1-2H3 |
|
inchikey |
RDOIQAHITMMDAJ-UHFFFAOYSA-N |
|
is bearer of | ||
is conjugate base of | ||
label |
Loperamide loperamide |
|
mass |
477.03800 |
|
monoisotopicmass |
476.22306 |
|
notation |
CHEBI:6532 |
|
prefixIRI |
CHEBI:6532 |
|
prefLabel |
Loperamide |
|
smiles |
CN(C)C(=O)C(CCN1CCC(O)(CC1)c1ccc(Cl)cc1)(c1ccccc1)c1ccccc1 |
|
textual definition |
A synthetic piperidine derivative, effective against diarrhoea resulting from gastroenteritis or inflammatory bowel disease. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83403 http://purl.obolibrary.org/obo/CHEBI_29347 |