loading...| Preferred Name | Lomustine | |
| Synonyms |
1-(2-chloroethyl)-3-cyclohexylnitrosourea cyclohexyl chloroethyl nitrosourea N-(2-chloroethyl)-N'-cyclohexyl-N-nitrosourea chloroethylcyclohexylnitrosourea 1-(2-Chloroethyl)-3-cyclohexyl-1-nitrosourea Belustine CCNU CINU Cecenu CeeNU lomustina lomustine lomustinum 1-(2-chloroethyl)-3-cyclohexyl-1-nitrosourea |
|
| Definitions |
An N-nitrosourea that is urea in which one of the nitrogens is substituted by a 2-chloroethyl group and by a nitroso group, while the other nitrogen is substituted by a cyclohexyl group. An alkylating antineoplastic agent, it is used in the treatment of brain tumours, lung cancer, malignant melanoma and other solid tumours. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6520 |
|
| alternative term |
1-(2-chloroethyl)-3-cyclohexylnitrosourea cyclohexyl chloroethyl nitrosourea N-(2-chloroethyl)-N'-cyclohexyl-N-nitrosourea chloroethylcyclohexylnitrosourea 1-(2-Chloroethyl)-3-cyclohexyl-1-nitrosourea Belustine CCNU CINU Cecenu CeeNU lomustina lomustine lomustinum 1-(2-chloroethyl)-3-cyclohexyl-1-nitrosourea |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
PMID:24368412 PMID:19901016 Reaxys:2125058 PMID:22577051 KEGG:C07079 PMID:12153595 PMID:20719460 Drug_Central:1596 PMID:24293673 DrugBank:DB01206 CAS:13010-47-4 Wikipedia:Lomustine HMDB:HMDB0015337 PMID:24516018 KEGG:D00363 PMID:6762924 |
|
| formula |
C9H16ClN3O2 |
|
| has role | ||
| has_exact_synonym |
1-(2-chloroethyl)-3-cyclohexyl-1-nitrosourea |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-(2-chloroethyl)-3-cyclohexylnitrosourea cyclohexyl chloroethyl nitrosourea N-(2-chloroethyl)-N'-cyclohexyl-N-nitrosourea chloroethylcyclohexylnitrosourea 1-(2-Chloroethyl)-3-cyclohexyl-1-nitrosourea Belustine CCNU CINU Cecenu CeeNU lomustina lomustine lomustinum |
|
| has_RxCUI |
6466 |
|
| id |
CHEBI:6520 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H16ClN3O2/c10-6-7-13(12-15)9(14)11-8-4-2-1-3-5-8/h8H,1-7H2,(H,11,14) |
|
| inchikey |
GQYIWUVLTXOXAJ-UHFFFAOYSA-N |
|
| label |
lomustine Lomustine |
|
| mass |
233.69500 |
|
| monoisotopicmass |
233.09310 |
|
| notation |
CHEBI:6520 |
|
| prefixIRI |
CHEBI:6520 |
|
| prefLabel |
Lomustine |
|
| smiles |
ClCCN(N=O)C(=O)NC1CCCCC1 |
|
| textual definition |
An N-nitrosourea that is urea in which one of the nitrogens is substituted by a 2-chloroethyl group and by a nitroso group, while the other nitrogen is substituted by a cyclohexyl group. An alkylating antineoplastic agent, it is used in the treatment of brain tumours, lung cancer, malignant melanoma and other solid tumours. |
|
| subClassOf |