loading...| Preferred Name | Nevirapine | |
| Synonyms |
11-cyclopropyl-5,11-dihydro-4-methyl-6H-dipyrido(3,2-b:2',3'-e)(1,4)diazepin-6-one NEV NVP Viramune nevirapine 11-cyclopropyl-4-methyl-5,11-dihydro-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepin-6-one Nevirapine |
|
| Definitions |
A dipyridodiazepine that is 5,11-dihydro-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepine which is substituted by methyl, oxo, and cyclopropyl groups at positions 4, 6, and 11, respectively. A non-nucleoside reverse transcriptase inhibitor with activity against HIV-1, it is used in combination with other antiretrovirals for the treatment of HIV infection. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_63613 |
|
| alternative term |
11-cyclopropyl-5,11-dihydro-4-methyl-6H-dipyrido(3,2-b:2',3'-e)(1,4)diazepin-6-one NEV NVP Viramune nevirapine 11-cyclopropyl-4-methyl-5,11-dihydro-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepin-6-one Nevirapine |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
PMID:28827836 PMID:25017682 KEGG:C07263 PMID:28835669 PMID:1712395 PMID:28782122 PMID:28786740 CAS:129618-40-2 Reaxys:4757598 DrugBank:DB00238 LINCS:LSM-5336 PMID:28819312 PDBeChem:NVP Wikipedia:Nevirapine KEGG:D00435 |
|
| formula |
C15H14N4O |
|
| has role | ||
| has_alternative_id |
CHEBI:7546 |
|
| has_exact_synonym |
11-cyclopropyl-4-methyl-5,11-dihydro-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepin-6-one Nevirapine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
11-cyclopropyl-5,11-dihydro-4-methyl-6H-dipyrido(3,2-b:2',3'-e)(1,4)diazepin-6-one NEV NVP Viramune nevirapine |
|
| has_RxCUI |
53654 |
|
| id |
CHEBI:63613 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H14N4O/c1-9-6-8-17-14-12(9)18-15(20)11-3-2-7-16-13(11)19(14)10-4-5-10/h2-3,6-8,10H,4-5H2,1H3,(H,18,20) |
|
| inchikey |
NQDJXKOVJZTUJA-UHFFFAOYSA-N |
|
| label |
Nevirapine nevirapine |
|
| mass |
266.29790 |
|
| monoisotopicmass |
266.11676 |
|
| notation |
CHEBI:63613 |
|
| prefixIRI |
CHEBI:63613 |
|
| prefLabel |
Nevirapine |
|
| smiles |
Cc1ccnc2N(C3CC3)c3ncccc3C(=O)Nc12 |
|
| textual definition |
A dipyridodiazepine that is 5,11-dihydro-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepine which is substituted by methyl, oxo, and cyclopropyl groups at positions 4, 6, and 11, respectively. A non-nucleoside reverse transcriptase inhibitor with activity against HIV-1, it is used in combination with other antiretrovirals for the treatment of HIV infection. |
|
| subClassOf |