Preferred Name |
donepezil |
|
Synonyms |
donepezilum donepezil donepezilo |
|
Definitions |
A racemate comprising equimolar amounts of (R)- and (S)-donepezil. A centrally acting reversible acetylcholinesterase inhibitor, its main therapeutic use is in the treatment of Alzheimer's disease where it is used to increase cortical acetylcholine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_53289 |
|
alternative term |
donepezilum donepezil donepezilo |
|
bearer_of |
http://purl.obolibrary.org/obo/CHEBI_66980 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Donepezil Drug_Central:946 KEGG:D07869 CAS:120014-06-4 Beilstein:7081955 Reaxys:7081955 DrugBank:DB00843 LINCS:LSM-1598 |
|
formula |
C24H29NO3 |
|
has part | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_66980 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
donepezilum donepezil donepezilo |
|
has_RxCUI |
135447 |
|
id |
CHEBI:53289 |
|
in_subset | ||
inchi |
InChI=1S/C24H29NO3/c1-27-22-14-19-13-20(24(26)21(19)15-23(22)28-2)12-17-8-10-25(11-9-17)16-18-6-4-3-5-7-18/h3-7,14-15,17,20H,8-13,16H2,1-2H3 |
|
inchikey |
ADEBPBSSDYVVLD-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
donepezil |
|
mass |
379.500 |
|
monoisotopicmass |
379.21474 |
|
notation |
CHEBI:53289 |
|
overlaps | ||
prefixIRI |
CHEBI:53289 |
|
prefLabel |
donepezil |
|
smiles |
C1(=C(C=C2C(=C1)CC(C2=O)(CC3CCN(CC3)CC4=CC=CC=C4)[H])OC)OC |
|
textual definition |
A racemate comprising equimolar amounts of (R)- and (S)-donepezil. A centrally acting reversible acetylcholinesterase inhibitor, its main therapeutic use is in the treatment of Alzheimer's disease where it is used to increase cortical acetylcholine. |
|
subClassOf |