loading...| Preferred Name | dutasteride | |
| Synonyms |
alpha,alpha,alpha,alpha',alpha',alpha'-hexafluoro-3-oxo-4-aza-5alpha-androst-1-ene-17beta-carboxy-2',5'-xylidide (5alpha,17beta)-N-(2,5-bis(trifluoromethyl)phenyl)-3-oxo-4-azaandrost-1-ene-17-carboxamide N-[2,5-bis(trifluoromethyl)phenyl]-3-oxo-4-aza-5alpha-androst-1-ene-17beta-carboxamide |
|
| Definitions |
An aza-steroid that is inasteride in which the tert-butyl group is replaced by a 2,5-bis(trifluoromethyl)phenyl group. A synthetic 4-azasteroid, dutasteride is a selective inhibitor of both the type 1 and type 2 isoforms of steroid 5alpha-reductase, an intracellular enzyme that converts testosterone to 5alpha-dihydrotestosterone. Dutasteride is used for the treatment of symptomatic benign prostatic hyperplasia in men with an enlarged prostate gland. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_521033 |
|
| alternative term |
alpha,alpha,alpha,alpha',alpha',alpha'-hexafluoro-3-oxo-4-aza-5alpha-androst-1-ene-17beta-carboxy-2',5'-xylidide (5alpha,17beta)-N-(2,5-bis(trifluoromethyl)phenyl)-3-oxo-4-azaandrost-1-ene-17-carboxamide N-[2,5-bis(trifluoromethyl)phenyl]-3-oxo-4-aza-5alpha-androst-1-ene-17beta-carboxamide |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
Patent:WO9507927 KEGG:D03820 Wikipedia:Dutasteride CAS:164656-23-9 DrugBank:DB01126 Drug_Central:973 Beilstein:7401530 |
|
| formula |
C27H30F6N2O2 |
|
| has parent hydride | ||
| has role | ||
| has_exact_synonym |
N-[2,5-bis(trifluoromethyl)phenyl]-3-oxo-4-aza-5alpha-androst-1-ene-17beta-carboxamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
alpha,alpha,alpha,alpha',alpha',alpha'-hexafluoro-3-oxo-4-aza-5alpha-androst-1-ene-17beta-carboxy-2',5'-xylidide (5alpha,17beta)-N-(2,5-bis(trifluoromethyl)phenyl)-3-oxo-4-azaandrost-1-ene-17-carboxamide |
|
| has_RxCUI |
228790 |
|
| id |
CHEBI:521033 |
|
| in_subset | ||
| inchi |
InChI=1S/C27H30F6N2O2/c1-24-11-9-17-15(4-8-21-25(17,2)12-10-22(36)35-21)16(24)6-7-19(24)23(37)34-20-13-14(26(28,29)30)3-5-18(20)27(31,32)33/h3,5,10,12-13,15-17,19,21H,4,6-9,11H2,1-2H3,(H,34,37)(H,35,36)/t15-,16-,17-,19+,21+,24-,25+/m0/s1 |
|
| inchikey |
JWJOTENAMICLJG-QWBYCMEYSA-N |
|
| label |
dutasteride Dutasteride |
|
| mass |
528.531 |
|
| monoisotopicmass |
528.22115 |
|
| notation |
CHEBI:521033 |
|
| prefixIRI |
CHEBI:521033 |
|
| prefLabel |
dutasteride |
|
| smiles |
C=1C(N[C@]2([C@@](C1)(C)[C@]3(CC[C@@]4([C@](CC[C@]4([C@]3([H])CC2)[H])(C(=O)NC5=CC(=CC=C5C(F)(F)F)C(F)(F)F)[H])C)[H])[H])=O |
|
| textual definition |
An aza-steroid that is inasteride in which the tert-butyl group is replaced by a 2,5-bis(trifluoromethyl)phenyl group. A synthetic 4-azasteroid, dutasteride is a selective inhibitor of both the type 1 and type 2 isoforms of steroid 5alpha-reductase, an intracellular enzyme that converts testosterone to 5alpha-dihydrotestosterone. Dutasteride is used for the treatment of symptomatic benign prostatic hyperplasia in men with an enlarged prostate gland. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35726 |