loading...| Preferred Name | mercaptopurine | |
| Synonyms |
Puri-Nethol 6-Mercaptopurine Mercaptopurina 6-Thiohypoxanthine mercaptopurinum mercaptopurine 6-Thioxopurine 6 MP 6-MP Mercapurin Purinethol 1,7-dihydro-6H-purine-6-thione Mercaptopurine |
|
| Definitions |
A member of the class of purines that is 6,7-dihydro-1H-purine carrying a thione group at position 6. An adenine analogue, it is used in the treatment of acute lymphocytic leukemia (ALL), chronic myeloid leukemia (CML), Crohn's disease, and ulcerative colitis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_50667 |
|
| alternative term |
Puri-Nethol 6-Mercaptopurine Mercaptopurina 6-Thiohypoxanthine mercaptopurinum mercaptopurine 6-Thioxopurine 6 MP 6-MP Mercapurin Purinethol 1,7-dihydro-6H-purine-6-thione Mercaptopurine |
|
| bearer_of |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:16267626 Patent:US2721866 PMID:28301625 KEGG:C02380 Reaxys:132916 DrugBank:DB01033 PMID:28406092 PMID:28212467 KEGG:D04931 CAS:50-44-2 Patent:US2697709 PDBeChem:PM6 Beilstein:132916 PMID:28166217 PMID:28484608 PMID:28011186 PMID:28295989 PMID:28574837 PMID:28418010 |
|
| formula |
C5H4N4S |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
| has_exact_synonym |
1,7-dihydro-6H-purine-6-thione Mercaptopurine mercaptopurine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Puri-Nethol 6-Mercaptopurine Mercaptopurina 6-Thiohypoxanthine mercaptopurinum mercaptopurine 6-Thioxopurine 6 MP 6-MP Mercapurin Purinethol |
|
| has_RxCUI |
103 |
|
| id |
CHEBI:50667 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H4N4S/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) |
|
| inchikey |
GLVAUDGFNGKCSF-UHFFFAOYSA-N |
|
| is tautomer of | ||
| label |
mercaptopurine |
|
| mass |
152.17822 |
|
| monoisotopicmass |
152.01567 |
|
| notation |
CHEBI:50667 |
|
| prefixIRI |
CHEBI:50667 |
|
| prefLabel |
mercaptopurine |
|
| smiles |
S=c1[nH]cnc2nc[nH]c12 |
|
| textual definition |
A member of the class of purines that is 6,7-dihydro-1H-purine carrying a thione group at position 6. An adenine analogue, it is used in the treatment of acute lymphocytic leukemia (ALL), chronic myeloid leukemia (CML), Crohn's disease, and ulcerative colitis. |
|
| subClassOf |