loading...| Preferred Name |
Etodolac |
|
| Synonyms |
1,8-diethyl-1,3,4,9-tetrahydropyrano(3,4-b)indole-1-acetic acid ETODOLIC ACID (+-)-1,8-diethyl-1,3,4,9-tetrahydropyrano(3,4-b)indole-1-acetic acid (1,8-Diethyl-1,3,4,9-tetrahydro-pyrano[3,4-b]indol-1-yl)-acetic acid 1,3,4,9-tetrahydro-1,8-diethylpyrano(3,4-b)indole-1-acetic acid 1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-ylacetic acid etodolac etodolaco etodolacum (1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetic acid ETODOLAC |
|
| Definitions |
A monocarboxylic acid that is acetic acid in which one of the methyl hydrogens is substituted by a 1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl moiety. A preferential inhibitor of cyclo-oxygenase 2 and non-steroidal anti-inflammatory, it is used for the treatment of rheumatoid arthritis and osteoarthritis, and for the alleviation of postoperative pain. Administered as the racemate, only the (S)-enantiomer is active. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4909 |
|
| alternative term |
1,8-diethyl-1,3,4,9-tetrahydropyrano(3,4-b)indole-1-acetic acid ETODOLIC ACID (+-)-1,8-diethyl-1,3,4,9-tetrahydropyrano(3,4-b)indole-1-acetic acid (1,8-Diethyl-1,3,4,9-tetrahydro-pyrano[3,4-b]indol-1-yl)-acetic acid 1,3,4,9-tetrahydro-1,8-diethylpyrano(3,4-b)indole-1-acetic acid 1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-ylacetic acid etodolac etodolaco etodolacum (1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetic acid ETODOLAC |
|
| bearer_of |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_50629 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Etodolac PMID:2970548 PMID:15369391 PMID:2527995 HMDB:HMDB0014887 Patent:DE2301525 LINCS:LSM-1781 DrugBank:DB00749 CAS:41340-25-4 PMID:28166217 Patent:US3939178 Drug_Central:1103 KEGG:D00315 |
|
| formula |
C17H21NO3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_50629 |
|
| has_alternative_id |
CHEBI:126431 |
|
| has_exact_synonym |
(1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetic acid ETODOLAC |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1,8-diethyl-1,3,4,9-tetrahydropyrano(3,4-b)indole-1-acetic acid ETODOLIC ACID (+-)-1,8-diethyl-1,3,4,9-tetrahydropyrano(3,4-b)indole-1-acetic acid (1,8-Diethyl-1,3,4,9-tetrahydro-pyrano[3,4-b]indol-1-yl)-acetic acid 1,3,4,9-tetrahydro-1,8-diethylpyrano(3,4-b)indole-1-acetic acid 1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-ylacetic acid etodolac etodolaco etodolacum |
|
| has_RxCUI |
24605 |
|
| id |
CHEBI:4909 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H21NO3/c1-3-11-6-5-7-12-13-8-9-21-17(4-2,10-14(19)20)16(13)18-15(11)12/h5-7,18H,3-4,8-10H2,1-2H3,(H,19,20) |
|
| inchikey |
NNYBQONXHNTVIJ-UHFFFAOYSA-N |
|
| label |
etodolac Etodolac |
|
| mass |
287.35350 |
|
| monoisotopicmass |
287.15214 |
|
| notation |
CHEBI:4909 |
|
| prefixIRI |
CHEBI:4909 |
|
| prefLabel |
Etodolac |
|
| smiles |
CCc1cccc2c3CCOC(CC)(CC(O)=O)c3[nH]c12 |
|
| textual definition |
A monocarboxylic acid that is acetic acid in which one of the methyl hydrogens is substituted by a 1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl moiety. A preferential inhibitor of cyclo-oxygenase 2 and non-steroidal anti-inflammatory, it is used for the treatment of rheumatoid arthritis and osteoarthritis, and for the alleviation of postoperative pain. Administered as the racemate, only the (S)-enantiomer is active. |
|
| subClassOf |