Preferred Name |
dofetilide |
|
Synonyms |
N-(4-{2-[methyl(2-{4-[(methylsulfonyl)amino]phenoxy}ethyl)amino]ethyl}phenyl)methanesulfonamide Dofetilide beta-((p-Methanesulfonamidophenethyl)methylamino)methanesulfono-p-phenetidide dofetilidum Tikosyn dofetilida dofetilide |
|
Definitions |
A tertiary amino compound that is N-ethyl-N-methylethanamine substituted by a 4-[(methylsulfonyl)amino]phenoxy and a 4-[(methylsulfonyl)amino]phenyl group at the terminal carbon atoms respectively. It is used as an anti-arrhythmia drug. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4681 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:3572833 CAS:115256-11-6 LINCS:LSM-5925 KEGG:C07751 KEGG:D00647 PMID:11326815 DrugBank:DB00204 Wikipedia:Dofetilide PMID:25620152 Patent:EP245997 Patent:US4959366 Drug_Central:942 PMID:25626340 |
|
formula |
C19H27N3O5S2 |
|
has role | ||
has_exact_synonym |
N-(4-{2-[methyl(2-{4-[(methylsulfonyl)amino]phenoxy}ethyl)amino]ethyl}phenyl)methanesulfonamide Dofetilide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
beta-((p-Methanesulfonamidophenethyl)methylamino)methanesulfono-p-phenetidide dofetilidum Tikosyn dofetilida dofetilide |
|
has_RxCUI |
49247 |
|
id |
CHEBI:4681 |
|
in_subset | ||
inchi |
InChI=1S/C19H27N3O5S2/c1-22(13-12-16-4-6-17(7-5-16)20-28(2,23)24)14-15-27-19-10-8-18(9-11-19)21-29(3,25)26/h4-11,20-21H,12-15H2,1-3H3 |
|
inchikey |
IXTMWRCNAAVVAI-UHFFFAOYSA-N |
|
label |
dofetilide |
|
mass |
441.56500 |
|
monoisotopicmass |
441.13921 |
|
notation |
CHEBI:4681 |
|
prefixIRI |
CHEBI:4681 |
|
prefLabel |
dofetilide |
|
smiles |
CN(CCOc1ccc(NS(C)(=O)=O)cc1)CCc1ccc(NS(C)(=O)=O)cc1 |
|
textual definition |
A tertiary amino compound that is N-ethyl-N-methylethanamine substituted by a 4-[(methylsulfonyl)amino]phenoxy and a 4-[(methylsulfonyl)amino]phenyl group at the terminal carbon atoms respectively. It is used as an anti-arrhythmia drug. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35358 |