Preferred Name |
Dobutamine |
|
Synonyms |
4-(2-{[4-(4-hydroxyphenyl)butan-2-yl]amino}ethyl)benzene-1,2-diol DOBUTAMINE Dobutamine rac-dobutamine 4-{2-[3-(4-Hydroxy-phenyl)-1-methyl-propylamino]-ethyl}-benzene-1,2-diol 3,4-dihydroxy-N-[3-(4-hydroxyphenyl)-1-methylpropyl]-beta-phenylethylamine (+-)-4-(2-((3-(p-hydroxyphenyl)-1-methylpropyl)amino)ethyl)pyrocatechol DL-dobutamine dobutaminum racemic-dobutamine dobutamina dobutamine |
|
Definitions |
A catecholamine that is 4-(3-aminobutyl)phenol in which one of the hydrogens attached to the nitrogen is substituted by a 2-(3,4-dihydroxyphenyl)ethyl group. A beta1-adrenergic receptor agonist that has cardiac stimulant action without evoking vasoconstriction or tachycardia, it is used as the hydrochloride to increase the contractility of the heart in the management of acute heart failure. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4670 |
|
charge |
0 |
|
database_cross_reference |
PMID:11280019 KEGG:C06967 Wikipedia:Dobutamine PMID:22537238 PMID:18323735 LINCS:LSM-1807 CAS:34368-04-2 KEGG:D03879 Drug_Central:937 DrugBank:DB00841 Reaxys:2946389 Patent:DE2317710 Patent:US3987200 Beilstein:2946389 PMID:11950781 HMDB:HMDB0014979 |
|
formula |
C18H23NO3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35524 |
|
has_alternative_id |
CHEBI:554519 CHEBI:184505 |
|
has_exact_synonym |
4-(2-{[4-(4-hydroxyphenyl)butan-2-yl]amino}ethyl)benzene-1,2-diol DOBUTAMINE Dobutamine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
rac-dobutamine 4-{2-[3-(4-Hydroxy-phenyl)-1-methyl-propylamino]-ethyl}-benzene-1,2-diol 3,4-dihydroxy-N-[3-(4-hydroxyphenyl)-1-methylpropyl]-beta-phenylethylamine (+-)-4-(2-((3-(p-hydroxyphenyl)-1-methylpropyl)amino)ethyl)pyrocatechol DL-dobutamine dobutaminum racemic-dobutamine dobutamina dobutamine |
|
has_RxCUI |
3616 |
|
id |
CHEBI:4670 |
|
in_subset | ||
inchi |
InChI=1S/C18H23NO3/c1-13(2-3-14-4-7-16(20)8-5-14)19-11-10-15-6-9-17(21)18(22)12-15/h4-9,12-13,19-22H,2-3,10-11H2,1H3 |
|
inchikey |
JRWZLRBJNMZMFE-UHFFFAOYSA-N |
|
label |
Dobutamine dobutamine |
|
mass |
301.38010 |
|
monoisotopicmass |
301.16779 |
|
notation |
CHEBI:4670 |
|
prefixIRI |
CHEBI:4670 |
|
prefLabel |
Dobutamine |
|
smiles |
CC(CCc1ccc(O)cc1)NCCc1ccc(O)c(O)c1 |
|
textual definition |
A catecholamine that is 4-(3-aminobutyl)phenol in which one of the hydrogens attached to the nitrogen is substituted by a 2-(3,4-dihydroxyphenyl)ethyl group. A beta1-adrenergic receptor agonist that has cardiac stimulant action without evoking vasoconstriction or tachycardia, it is used as the hydrochloride to increase the contractility of the heart in the management of acute heart failure. |
|
subClassOf |