Preferred Name | dipivefrin | |
Synonyms |
Dipivefrine dipivefrina dipivefrine dipivefrinum 4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate (+-)-4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate dipivalyl epinephrine 1-(3',4'-dipivaloyloxyphenyl)-2-methylamino-1-ethanol 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diyl bis(2,2-dimethylpropanoate) Dipivefrin |
|
Definitions |
The dipivalate ester of (+-)-epinephrine (racepinephrine). A pro-drug of epinephrine, the hydrochloride is used topically as eye drops to reduce intra-ocular pressure in the treatment of open-angle glaucoma or ocular hypertension. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4646 |
|
alternative term |
Dipivefrine dipivefrina dipivefrine dipivefrinum 4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate (+-)-4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate dipivalyl epinephrine 1-(3',4'-dipivaloyloxyphenyl)-2-methylamino-1-ethanol 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diyl bis(2,2-dimethylpropanoate) Dipivefrin |
|
bearer_of |
http://purl.obolibrary.org/obo/CHEBI_39456 http://purl.obolibrary.org/obo/CHEBI_35524 http://purl.obolibrary.org/obo/CHEBI_37886 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:922 Patent:US3809714 KEGG:C06963 Patent:DE2343657 CAS:52365-63-6 LINCS:LSM-1583 Patent:US4085270 Patent:DE2152058 Wikipedia:Dipivefrin KEGG:D02349 DrugBank:DB00449 Beilstein:2165183 |
|
formula |
C19H29NO5 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_39456 http://purl.obolibrary.org/obo/CHEBI_35524 http://purl.obolibrary.org/obo/CHEBI_37886 |
|
has_exact_synonym |
4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diyl bis(2,2-dimethylpropanoate) Dipivefrin |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Dipivefrine dipivefrina dipivefrine dipivefrinum 4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate (+-)-4-[1-hydroxy-2-(methylamino)ethyl]-o-phenylene divavalate dipivalyl epinephrine 1-(3',4'-dipivaloyloxyphenyl)-2-methylamino-1-ethanol |
|
has_RxCUI |
23410 |
|
id |
CHEBI:4646 |
|
in_subset | ||
inchi |
InChI=1S/C19H29NO5/c1-18(2,3)16(22)24-14-9-8-12(13(21)11-20-7)10-15(14)25-17(23)19(4,5)6/h8-10,13,20-21H,11H2,1-7H3 |
|
inchikey |
OCUJLLGVOUDECM-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
Dipivefrin dipivefrin |
|
mass |
351.43730 |
|
monoisotopicmass |
351.20457 |
|
notation |
CHEBI:4646 |
|
prefixIRI |
CHEBI:4646 |
|
prefLabel |
dipivefrin |
|
smiles |
CNCC(O)c1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1 |
|
textual definition |
The dipivalate ester of (+-)-epinephrine (racepinephrine). A pro-drug of epinephrine, the hydrochloride is used topically as eye drops to reduce intra-ocular pressure in the treatment of open-angle glaucoma or ocular hypertension. |
|
subClassOf |