Preferred Name |
Dienestrol |
|
Synonyms |
4,4'-hexa-2,4-diene-3,4-diyldiphenol Dienestrol 4,4'-Hydroxy-gamma,delta-diphenyl-beta,delta-hexadiene Di(p-oxyphenyl)-2,4-hexadiene p,p'-(Diethylideneethylene)diphenol Dehydrostilbestrol dienestrol |
|
Definitions |
An olefinic compound that is hexa-2,4-diene substituted by 4-hydroxyphenyl groups at positions 3 and 4 respectively. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4518 |
|
charge |
0 |
|
database_cross_reference |
KEGG:C08090 Patent:US2464203 Patent:US2465505 KEGG:D00898 PMID:25188907 CAS:84-17-3 Wikipedia:Dienestrol Reaxys:2053692 PMID:18275104 DrugBank:DB00890 LINCS:LSM-4142 |
|
formula |
C18H18O2 |
|
has role | ||
has_exact_synonym |
4,4'-hexa-2,4-diene-3,4-diyldiphenol Dienestrol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4,4'-Hydroxy-gamma,delta-diphenyl-beta,delta-hexadiene Di(p-oxyphenyl)-2,4-hexadiene p,p'-(Diethylideneethylene)diphenol Dehydrostilbestrol dienestrol |
|
has_RxCUI |
3368 |
|
id |
CHEBI:4518 |
|
in_subset | ||
inchi |
InChI=1S/C18H18O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h3-12,19-20H,1-2H3 |
|
inchikey |
NFDFQCUYFHCNBW-UHFFFAOYSA-N |
|
label |
Dienestrol dienestrol |
|
mass |
266.33432 |
|
monoisotopicmass |
266.13068 |
|
notation |
CHEBI:4518 |
|
prefixIRI |
CHEBI:4518 |
|
prefLabel |
Dienestrol |
|
smiles |
CC=C(c1ccc(O)cc1)C(=CC)c1ccc(O)cc1 |
|
textual definition |
An olefinic compound that is hexa-2,4-diene substituted by 4-hydroxyphenyl groups at positions 3 and 4 respectively. |
|
subClassOf |