loading...| Preferred Name | nimesulide | |
| Synonyms |
4-NITRO-2-PHENOXYMETHANESULFONANILIDE 4'-nitro-2'-phenoxymethanesulfonanilide N-(4-nitro-2-phenoxyphenyl)methanesulfonamide Nimesulide |
|
| Definitions |
An aromatic ether having phenyl and 2-methylsulfonamido-5-nitrophenyl as the two aryl groups. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_44445 |
|
| alternative term |
4-NITRO-2-PHENOXYMETHANESULFONANILIDE 4'-nitro-2'-phenoxymethanesulfonanilide N-(4-nitro-2-phenoxyphenyl)methanesulfonamide Nimesulide |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
PMID:18426087 PDBeChem:NIM Drug_Central:1935 Wikipedia:Nimesulide Beilstein:2421175 Reaxys:2421175 CAS:51803-78-2 KEGG:D01049 LINCS:LSM-3718 DrugBank:DB04743 VSDB:1893 |
|
| formula |
C13H12N2O5S |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:44440 CHEBI:7574 |
|
| has_exact_synonym |
N-(4-nitro-2-phenoxyphenyl)methanesulfonamide Nimesulide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4-NITRO-2-PHENOXYMETHANESULFONANILIDE 4'-nitro-2'-phenoxymethanesulfonanilide |
|
| has_RxCUI |
53694 |
|
| id |
CHEBI:44445 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H12N2O5S/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h2-9,14H,1H3 |
|
| inchikey |
HYWYRSMBCFDLJT-UHFFFAOYSA-N |
|
| label |
nimesulide |
|
| mass |
308.31000 |
|
| monoisotopicmass |
308.04669 |
|
| notation |
CHEBI:44445 |
|
| prefixIRI |
CHEBI:44445 |
|
| prefLabel |
nimesulide |
|
| smiles |
CS(=O)(=O)Nc1ccc(cc1Oc1ccccc1)[N+]([O-])=O |
|
| textual definition |
An aromatic ether having phenyl and 2-methylsulfonamido-5-nitrophenyl as the two aryl groups. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35358 |