Preferred Name |
benzyl benzoate |
|
Synonyms |
benzoic acid, benzyl ester BENZOIC ACID PHENYLMETHYLESTER benzoic acid, phenylmethyl ester phenylmethyl benzoate Benylate benzyl benzoate |
|
Definitions |
A benzoate ester obtained by the formal condensation of benzoic acid with benzyl alcohol. It has been isolated from the plant species of the genus Polyalthia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_41237 |
|
alternative term |
benzoic acid, benzyl ester BENZOIC ACID PHENYLMETHYLESTER benzoic acid, phenylmethyl ester phenylmethyl benzoate Benylate benzyl benzoate |
|
bearer_of |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Benzyl_Benzoate PDBeChem:BZM PMID:24761672 PMID:19681271 PMID:18247142 MetaCyc:CPD-6443 PMID:24146308 CAS:120-51-4 HMDB:HMDB0014814 PMID:24520907 Beilstein:2049280 Drug_Central:335 KEGG:D01138 DrugBank:DB00676 Reaxys:2049280 Gmelin:261816 PPDB:1473 VSDB:1473 |
|
formula |
C14H12O2 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
has_alternative_id |
CHEBI:41230 CHEBI:31267 |
|
has_exact_synonym |
benzyl benzoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
benzoic acid, benzyl ester BENZOIC ACID PHENYLMETHYLESTER benzoic acid, phenylmethyl ester phenylmethyl benzoate Benylate |
|
has_RxCUI |
19044 |
|
id |
CHEBI:41237 |
|
in_subset | ||
inchi |
InChI=1S/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
|
inchikey |
SESFRYSPDFLNCH-UHFFFAOYSA-N |
|
label |
benzyl benzoate |
|
mass |
212.24388 |
|
monoisotopicmass |
212.08373 |
|
notation |
CHEBI:41237 |
|
prefixIRI |
CHEBI:41237 |
|
prefLabel |
benzyl benzoate |
|
smiles |
O=C(OCc1ccccc1)c1ccccc1 |
|
textual definition |
A benzoate ester obtained by the formal condensation of benzoic acid with benzyl alcohol. It has been isolated from the plant species of the genus Polyalthia. |
|
subClassOf |