Preferred Name |
ergoline |
|
Synonyms |
ergoline (2R,7R)-6,11-diazatetracyclo[7.6.1.0(2,7).0(12,16)]hexadeca-1(16),9,12,14-tetraene (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline (6aR-trans)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline ergoline I |
|
Definitions |
An indole alkaloid whose structural skeleton is found in many naturally occurring and synthetic ergolines which are known to bind to neurotransmitter receptors, such as dopamine, noradrenaline and serotonin receptors and function as unselective agonists or antagonists at these receptors. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_38484 |
|
charge |
0 |
|
database_cross_reference |
CAS:478-88-6 PMID:19783143 PMID:423180 Wikipedia:Ergoline Chemspider:5256873 PMID:23659323 PMID:16944356 PMID:18031017 PMID:31621316 PMID:13217 |
|
formula |
C14H16N2 |
|
has_alternative_id |
CHEBI:35503 CHEBI:23326 |
|
has_exact_synonym |
ergoline |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(2R,7R)-6,11-diazatetracyclo[7.6.1.0(2,7).0(12,16)]hexadeca-1(16),9,12,14-tetraene (6aR,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline (6aR-trans)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline ergoline I |
|
id |
CHEBI:38484 |
|
in_subset | ||
inchi |
InChI=1S/C14H16N2/c1-3-11-10-4-2-6-15-13(10)7-9-8-16-12(5-1)14(9)11/h1,3,5,8,10,13,15-16H,2,4,6-7H2/t10-,13-/m1/s1 |
|
inchikey |
RHGUXDUPXYFCTE-ZWNOBZJWSA-N |
|
label |
ergoline |
|
mass |
212.29032 |
|
monoisotopicmass |
212.13135 |
|
notation |
CHEBI:38484 |
|
prefLabel |
ergoline |
|
smiles |
[H][C@@]12Cc3c[nH]c4cccc(c34)[C@@]1([H])CCCN2 |
|
textual definition |
An indole alkaloid whose structural skeleton is found in many naturally occurring and synthetic ergolines which are known to bind to neurotransmitter receptors, such as dopamine, noradrenaline and serotonin receptors and function as unselective agonists or antagonists at these receptors. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38482 http://purl.obolibrary.org/obo/CHEBI_38958 http://purl.obolibrary.org/obo/CHEBI_60529 |