Preferred Name |
Cilazapril |
|
Synonyms |
Cilazapril anhydrous cilazaprilum Dynorm Inhibace Ro 34-2848 Vascace Vascase cilazapril (1S,9S)-9-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid |
|
Definitions |
A pyridazinodiazepine resulting from the formal condensation of the carboxy group of cilazaprilat with ethanol. It is a drug used in the treatment of hypertension and heart failure. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3698 |
|
alternative term |
Cilazapril anhydrous cilazaprilum Dynorm Inhibace Ro 34-2848 Vascace Vascase cilazapril (1S,9S)-9-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid |
|
bearer_of |
http://purl.obolibrary.org/obo/CHEBI_35674 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:641 HMDB:HMDB0015433 PMID:25272892 KEGG:D07699 CAS:88768-40-5 PMID:24383331 PMID:1836986 PMID:21760854 DrugBank:DB01340 PMID:28334985 PMID:18297254 Wikipedia:Cilazapril PMID:24754013 PMID:31531043 PMID:28445944 |
|
formula |
C22H31N3O5 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35674 |
|
has_exact_synonym |
(1S,9S)-9-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}-10-oxooctahydro-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Cilazapril anhydrous cilazaprilum Dynorm Inhibace Ro 34-2848 Vascace Vascase cilazapril |
|
has_RxCUI |
21102 |
|
id |
CHEBI:3698 |
|
in_subset | ||
inchi |
InChI=1S/C22H31N3O5/c1-2-30-22(29)18(13-12-16-8-4-3-5-9-16)23-17-10-6-14-24-15-7-11-19(21(27)28)25(24)20(17)26/h3-5,8-9,17-19,23H,2,6-7,10-15H2,1H3,(H,27,28)/t17-,18-,19-/m0/s1 |
|
inchikey |
HHHKFGXWKKUNCY-FHWLQOOXSA-N |
|
is bearer of | ||
label |
cilazapril Cilazapril |
|
mass |
417.506 |
|
monoisotopicmass |
417.22637 |
|
notation |
CHEBI:3698 |
|
prefixIRI |
CHEBI:3698 |
|
prefLabel |
Cilazapril |
|
smiles |
C1CC[C@@H](C(N2N1CCC[C@H]2C(=O)O)=O)N[C@H](C(OCC)=O)CCC3=CC=CC=C3 |
|
textual definition |
A pyridazinodiazepine resulting from the formal condensation of the carboxy group of cilazaprilat with ethanol. It is a drug used in the treatment of hypertension and heart failure. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36244 |