loading...| Preferred Name |
Chloroform |
|
| Synonyms |
1,1,1-trichloromethane Trichlormethan chloroformium pro narcosi trichloromethane chloroforme CHCl3 Chloroform chloroform |
|
| Definitions |
A one-carbon compound that is methane in which three of the hydrogens are replaced by chlorines. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_35255 |
|
| alternative term |
1,1,1-trichloromethane Trichlormethan chloroformium pro narcosi trichloromethane chloroforme CHCl3 Chloroform chloroform |
|
| bearer_of |
http://purl.obolibrary.org/obo/CHEBI_35470 http://purl.obolibrary.org/obo/CHEBI_38870 http://purl.obolibrary.org/obo/CHEBI_50903 |
|
| charge |
0 |
|
| database_cross_reference |
Gmelin:1837 PMID:8476536 HMDB:HMDB0029596 PMID:20051454 PMID:15583552 PMID:10379014 Beilstein:1731042 Wikipedia:Chloroform LINCS:LSM-37229 PDBeChem:MCH PMID:8625290 MetaCyc:CPD-843 Drug_Central:4363 Reaxys:1731042 CAS:67-66-3 PMID:21850127 KEGG:C13827 UM-BBD_compID:c0595 PMID:23093177 |
|
| formula |
CHCl3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35470 http://purl.obolibrary.org/obo/CHEBI_38870 http://purl.obolibrary.org/obo/CHEBI_50903 |
|
| has_alternative_id |
CHEBI:23143 CHEBI:34628 |
|
| has_exact_synonym |
Chloroform chloroform |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1,1,1-trichloromethane Trichlormethan chloroformium pro narcosi trichloromethane chloroforme CHCl3 |
|
| has_RxCUI |
1362698 |
|
| id |
CHEBI:35255 |
|
| in_subset | ||
| inchi |
InChI=1S/CHCl3/c2-1(3)4/h1H |
|
| inchikey |
HEDRZPFGACZZDS-UHFFFAOYSA-N |
|
| label |
Chloroform chloroform |
|
| mass |
119.37674 |
|
| monoisotopicmass |
117.91438 |
|
| notation |
CHEBI:35255 |
|
| prefixIRI |
CHEBI:35255 |
|
| prefLabel |
Chloroform |
|
| smiles |
[H]C(Cl)(Cl)Cl |
|
| textual definition |
A one-carbon compound that is methane in which three of the hydrogens are replaced by chlorines. |
|
| subClassOf |