Preferred Name |
dibutyl phthalate |
|
Synonyms |
dibutyl benzene-1,2-dicarboxylate Dibutyl phthalate Dibutyl-o-phthalate Phthalic acid dibutyl ester Dibutyl o-phthalate 1,2-Benzenedicarboxylic acid dibutyl ester Phthalic acid di-n-butyl ester n-Butyl phthalate Benzenedicarboxylic acid dibutyl ester Dibutyl 1,2-benzenedicarboxylate Butyl phthalate Benzene-o-dicarboxylic acid di-n-butyl ester o-Benzenedicarboxylic acid dibutyl ester Di-n-butyl phthalate DBP |
|
Definitions |
A phthalate ester that is the diester obtained by the formal condensation of the carboxy groups of phthalic acid with two molecules of butan-1-ol. Although used extensively as a plasticiser, it is a ubiquitous environmental contaminant that poses a risk to humans. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_34687 |
|
charge |
0 |
|
database_cross_reference |
PMID:24616073 PMID:28753974 CAS:84-74-2 KEGG:C14214 PMID:28823096 PMID:16232742 Beilstein:1914064 Drug_Central:4414 PMID:11133400 PMID:28486587 PMID:28566680 HMDB:HMDB0033244 PMID:24468924 PMID:26730679 PMID:27655612 PMID:19840837 PMID:28580302 PMID:28363850 PMID:28822891 PMID:28102498 Reaxys:1914064 PMID:24213843 Wikipedia:Dibutyl_phthalate Gmelin:262569 PPDB:2924 |
|
formula |
C16H22O4 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_50905 http://purl.obolibrary.org/obo/CHEBI_79056 http://purl.obolibrary.org/obo/CHEBI_25212 |
|
has_alternative_id |
CHEBI:535597 |
|
has_exact_synonym |
dibutyl benzene-1,2-dicarboxylate Dibutyl phthalate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Dibutyl-o-phthalate Phthalic acid dibutyl ester Dibutyl o-phthalate 1,2-Benzenedicarboxylic acid dibutyl ester Phthalic acid di-n-butyl ester n-Butyl phthalate Benzenedicarboxylic acid dibutyl ester Dibutyl 1,2-benzenedicarboxylate Butyl phthalate Benzene-o-dicarboxylic acid di-n-butyl ester o-Benzenedicarboxylic acid dibutyl ester Di-n-butyl phthalate DBP |
|
has_RxCUI |
1362873 |
|
id |
CHEBI:34687 |
|
in_subset | ||
inchi |
InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 |
|
inchikey |
DOIRQSBPFJWKBE-UHFFFAOYSA-N |
|
label |
dibutyl phthalate Dibutyl Phthalate |
|
mass |
278.34350 |
|
monoisotopicmass |
278.15181 |
|
notation |
CHEBI:34687 |
|
prefixIRI |
CHEBI:34687 |
|
prefLabel |
dibutyl phthalate |
|
smiles |
CCCCOC(=O)c1ccccc1C(=O)OCCCC |
|
textual definition |
A phthalate ester that is the diester obtained by the formal condensation of the carboxy groups of phthalic acid with two molecules of butan-1-ol. Although used extensively as a plasticiser, it is a ubiquitous environmental contaminant that poses a risk to humans. |
|
subClassOf |