Preferred Name |
Carboprost |
|
Synonyms |
(5Z,13E,15S)-9alpha,11alpha,15-trihydroxy-15-methylprosta-5,13-dien-1-oic acid 15(S)-15-methylprostaglandin F2alpha (15S)-15-methylprostaglandin F2alpha carboprostum (15S)-15-methyl-PGF2alpha 15(S)-15-methyl-PGF2alpha carboprost |
|
Definitions |
Prostaglandin F2alpha in which the hydrogen at position 15 is substituted by methyl (S configuration). It is used as an abortifacient agent that is effective in both the first and second trimesters of pregnancy. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3403 |
|
charge |
0 |
|
database_cross_reference |
PMID:26622459 PMID:25822922 Beilstein:2949991 PMID:25643261 PMID:28526143 Patent:US3728382 PMID:26149245 PMID:24348762 DrugBank:DB00429 Drug_Central:502 PMID:17692579 PMID:15104835 PMID:27651609 Patent:DE2121980 PMID:32695003 PMID:17267874 KEGG:D02343 KEGG:C06872 PMID:30293295 Chemspider:4444532 CAS:35700-23-3 Wikipedia:Carboprost |
|
formula |
C21H36O5 |
|
has functional parent | ||
has role | ||
has_exact_synonym |
(5Z,13E,15S)-9alpha,11alpha,15-trihydroxy-15-methylprosta-5,13-dien-1-oic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
15(S)-15-methylprostaglandin F2alpha (15S)-15-methylprostaglandin F2alpha carboprostum (15S)-15-methyl-PGF2alpha 15(S)-15-methyl-PGF2alpha carboprost |
|
has_RxCUI |
2051 |
|
id |
CHEBI:3403 |
|
in_subset | ||
inchi |
InChI=1S/C21H36O5/c1-3-4-9-13-21(2,26)14-12-17-16(18(22)15-19(17)23)10-7-5-6-8-11-20(24)25/h5,7,12,14,16-19,22-23,26H,3-4,6,8-11,13,15H2,1-2H3,(H,24,25)/b7-5-,14-12+/t16-,17-,18+,19-,21+/m1/s1 |
|
inchikey |
DLJKPYFALUEJCK-IIELGFQLSA-N |
|
is conjugate acid of | ||
label |
carboprost Carboprost |
|
mass |
368.514 |
|
monoisotopicmass |
368.25627 |
|
notation |
CHEBI:3403 |
|
prefixIRI |
CHEBI:3403 |
|
prefLabel |
Carboprost |
|
smiles |
CCCCC[C@](C)(O)\C=C\[C@H]1[C@H](O)C[C@H](O)[C@@H]1C\C=C/CCCC(O)=O |
|
textual definition |
Prostaglandin F2alpha in which the hydrogen at position 15 is substituted by methyl (S configuration). It is used as an abortifacient agent that is effective in both the first and second trimesters of pregnancy. |
|
subClassOf |