loading...| Preferred Name | 4-Aminobenzoic Acid | |
| Synonyms |
gamma-aminobenzoic acid p-carboxyphenylamine 4-Amino-benzoic acid p-Aminobenzoesaeure para-aminobenzoic acid 1-Amino-4-carboxybenzene 4-Carboxyphenylamine gamma-Aminobenzoic acid p-carboxyaniline 4-Carboxyaniline p-aminobenzoic acid 4-Aminobenzoesaeure ABEE PABA 4-AMINOBENZOIC ACID 4-aminobenzoic acid 4-Aminobenzoic acid |
|
| Definitions |
An aminobenzoic acid in which the amino group is para to the carboxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30753 |
|
| alternative term |
gamma-aminobenzoic acid p-carboxyphenylamine 4-Amino-benzoic acid p-Aminobenzoesaeure para-aminobenzoic acid 1-Amino-4-carboxybenzene 4-Carboxyphenylamine gamma-Aminobenzoic acid p-carboxyaniline 4-Carboxyaniline p-aminobenzoic acid 4-Aminobenzoesaeure ABEE PABA 4-AMINOBENZOIC ACID 4-aminobenzoic acid 4-Aminobenzoic acid |
|
| bearer_of |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:4-Aminobenzoic_acid PMID:16290145 PMID:17149871 PMID:3599019 KEGG:D02456 PMID:19469519 PDBeChem:PAB PMID:12039592 Reaxys:471605 KNApSAcK:C00001401 Beilstein:471605 PMID:22994574 Gmelin:50150 DrugBank:DB02362 ECMDB:ECMDB01392 PMID:3820215 PMID:14745019 PMID:23063996 PMID:8411009 PMID:23084339 Drug_Central:2049 PMID:15115392 CAS:150-13-0 PMID:22767283 PMID:1527790 HMDB:HMDB0001392 PMID:17743450 PMID:23471007 PMID:9406595 KEGG:C00568 YMDB:YMDB00493 PMID:17800214 PMID:3950915 PMID:23144588 |
|
| formula |
C7H7NO2 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 |
|
| has_alternative_id |
CHEBI:113372 CHEBI:20315 CHEBI:44778 CHEBI:1783 |
|
| has_exact_synonym |
4-AMINOBENZOIC ACID 4-aminobenzoic acid 4-Aminobenzoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
gamma-aminobenzoic acid p-carboxyphenylamine 4-Amino-benzoic acid p-Aminobenzoesaeure para-aminobenzoic acid 1-Amino-4-carboxybenzene 4-Carboxyphenylamine gamma-Aminobenzoic acid p-carboxyaniline 4-Carboxyaniline p-aminobenzoic acid 4-Aminobenzoesaeure ABEE PABA |
|
| has_RxCUI |
74 |
|
| id |
CHEBI:30753 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10) |
|
| inchikey |
ALYNCZNDIQEVRV-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is tautomer of | ||
| label |
4-aminobenzoic acid 4-Aminobenzoic Acid |
|
| mass |
137.136 |
|
| monoisotopicmass |
137.04768 |
|
| notation |
CHEBI:30753 |
|
| prefixIRI |
CHEBI:30753 |
|
| prefLabel |
4-Aminobenzoic Acid |
|
| smiles |
C1(C(O)=O)=CC=C(N)C=C1 |
|
| textual definition |
An aminobenzoic acid in which the amino group is para to the carboxy group. |
|
| subClassOf |