Preferred Name |
Benztropine |
|
Synonyms |
benzatropina benzatropine benzhydryl 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ether benzatropinum tropine benzohydryl ether 3alpha-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane 3alpha-(diphenylmethoxy)tropane Benztropine 3alpha-(diphenylmethoxy)-1alphaH,5alphaH-tropane 3endo-benzhydryloxytropane Benzatropine (3-endo)-3-(diphenylmethoxy)-8-methyl-8-azabicyclo[3.2.1]octane |
|
Definitions |
Tropane in which a hydrogen at position 3 is substituted by a diphenylmethoxy group (endo-isomer). An acetylcholine receptor antagonist, it is used (particularly as its methanesulphonate salt) in the treatment of Parkinson's disease, and to reduce parkinsonism and akathisia side effects of antipsychotic treatments. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3048 |
|
alternative term |
benzatropina benzatropine benzhydryl 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ether benzatropinum tropine benzohydryl ether 3alpha-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane 3alpha-(diphenylmethoxy)tropane Benztropine 3alpha-(diphenylmethoxy)-1alphaH,5alphaH-tropane 3endo-benzhydryloxytropane Benzatropine (3-endo)-3-(diphenylmethoxy)-8-methyl-8-azabicyclo[3.2.1]octane |
|
bearer_of |
http://purl.obolibrary.org/obo/CHEBI_66956 http://purl.obolibrary.org/obo/CHEBI_48876 http://purl.obolibrary.org/obo/CHEBI_50370 |
|
charge |
0 |
|
database_cross_reference |
Patent:US2595405 Beilstein:90688 Drug_Central:333 Wikipedia:Benzatropine CAS:86-13-5 DrugBank:DB00245 KEGG:D07511 KEGG:C06846 |
|
formula |
C21H25NO |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_66956 http://purl.obolibrary.org/obo/CHEBI_48876 http://purl.obolibrary.org/obo/CHEBI_50370 |
|
has_alternative_id |
CHEBI:661238 |
|
has_exact_synonym |
Benzatropine (3-endo)-3-(diphenylmethoxy)-8-methyl-8-azabicyclo[3.2.1]octane |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
benzatropina benzatropine benzhydryl 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ether benzatropinum tropine benzohydryl ether 3alpha-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane 3alpha-(diphenylmethoxy)tropane Benztropine 3alpha-(diphenylmethoxy)-1alphaH,5alphaH-tropane 3endo-benzhydryloxytropane |
|
has_RxCUI |
1424 |
|
id |
CHEBI:3048 |
|
in_subset | ||
inchi |
InChI=1S/C21H25NO/c1-22-18-12-13-19(22)15-20(14-18)23-21(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18-21H,12-15H2,1H3/t18-,19+,20+ |
|
inchikey |
GIJXKZJWITVLHI-PMOLBWCYSA-N |
|
label |
benzatropine Benztropine |
|
mass |
307.42930 |
|
monoisotopicmass |
307.19361 |
|
notation |
CHEBI:3048 |
|
prefixIRI |
CHEBI:3048 |
|
prefLabel |
Benztropine |
|
smiles |
[H][C@]1(C[C@]2([H])CC[C@]([H])(C1)N2C)OC(c1ccccc1)c1ccccc1 |
|
textual definition |
Tropane in which a hydrogen at position 3 is substituted by a diphenylmethoxy group (endo-isomer). An acetylcholine receptor antagonist, it is used (particularly as its methanesulphonate salt) in the treatment of Parkinson's disease, and to reduce parkinsonism and akathisia side effects of antipsychotic treatments. |
|
subClassOf |