Preferred Name | barbiturate | |
Synonyms |
barbiturate anion 2,4,6-trioxotetrahydro-2H-pyrimidin-1-ide |
|
Definitions |
Conjugate base of barbituric acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_29745 |
|
alternative term |
barbiturate anion 2,4,6-trioxotetrahydro-2H-pyrimidin-1-ide |
|
charge |
-1 |
|
database_cross_reference |
KEGG:C00813 Gmelin:601777 |
|
formula |
C4H3N2O3 |
|
has_alternative_id |
CHEBI:13872 CHEBI:22690 |
|
has_exact_synonym |
2,4,6-trioxotetrahydro-2H-pyrimidin-1-ide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
barbiturate anion |
|
id |
CHEBI:29745 |
|
in_subset | ||
inchi |
InChI=1S/C4H4N2O3/c7-2-1-3(8)6-4(9)5-2/h1H2,(H2,5,6,7,8,9)/p-1 |
|
inchikey |
HNYOPLTXPVRDBG-UHFFFAOYSA-M |
|
is conjugate base of | ||
label |
barbiturate |
|
mass |
127.07820 |
|
monoisotopicmass |
127.01492 |
|
notation |
CHEBI:29745 |
|
prefLabel |
barbiturate |
|
smiles |
O=C1CC(=O)[N-]C(=O)N1 |
|
textual definition |
Conjugate base of barbituric acid. |
|
subClassOf |
Create mapping