Preferred Name |
Stigmasterol |
|
Synonyms |
(22E)-stigmasta-5,22-dien-3beta-ol Stigmasterol stigmasterol phytosterol 5,22-Cholestadien-24-ethyl-3beta-ol (3beta,22E)-stigmasta-5,22-dien-3-ol poriferasterol beta-stigmasterol stigmasta-5,22-dien-3beta-ol |
|
Definitions |
A 3beta-sterol that consists of 3beta-hydroxystigmastane having double bonds at the 5,6- and 22,23-positions. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28824 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Stigmasterol LIPID_MAPS_instance:LMST01040123 PMID:13547565 KEGG:C05442 KNApSAcK:C00023774 Beilstein:2568182 CAS:83-48-7 KNApSAcK:C00003674 Reaxys:2568182 PMID:13318319 HMDB:HMDB0000937 |
|
formula |
C29H48O |
|
has parent hydride | ||
has role | ||
has_alternative_id |
CHEBI:26774 CHEBI:8195 |
|
has_exact_synonym |
(22E)-stigmasta-5,22-dien-3beta-ol Stigmasterol stigmasterol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
phytosterol 5,22-Cholestadien-24-ethyl-3beta-ol (3beta,22E)-stigmasta-5,22-dien-3-ol poriferasterol beta-stigmasterol stigmasta-5,22-dien-3beta-ol |
|
has_RxCUI |
10079 |
|
id |
CHEBI:28824 |
|
in_subset | ||
inchi |
InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-10,19-21,23-27,30H,7,11-18H2,1-6H3/b9-8+/t20-,21-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
|
inchikey |
HCXVJBMSMIARIN-PHZDYDNGSA-N |
|
label |
Stigmasterol stigmasterol |
|
mass |
412.69082 |
|
monoisotopicmass |
412.37052 |
|
notation |
CHEBI:28824 |
|
prefixIRI |
CHEBI:28824 |
|
prefLabel |
Stigmasterol |
|
smiles |
[H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)\C=C\[C@@H](CC)C(C)C |
|
textual definition |
A 3beta-sterol that consists of 3beta-hydroxystigmastane having double bonds at the 5,6- and 22,23-positions. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_131703 http://purl.obolibrary.org/obo/CHEBI_1722 |