Preferred Name |
5-Hydroxytryptophan |
|
Synonyms |
5-Hydroxytryptophan 5-hydroxytryptophan 2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid 5-hydroxy-DL-tryptophan 5-hydroxytryptophan DL-form (+-)-5-hydroxytryptophan DL-5-hydroxytryptophan 5-HTP DL-5-HTP |
|
Definitions |
A tryptophan derivative that is tryptophan substituted by a hydroxy group at position 5. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28171 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:5-Hydroxytryptophan KEGG:C01017 CAS:114-03-4 Beilstein:88199 PMID:15617538 KNApSAcK:C00001371 PMID:14563478 Reaxys:88199 CAS:56-69-9 |
|
formula |
C11H12N2O3 |
|
has role | ||
has_alternative_id |
CHEBI:20595 CHEBI:2081 |
|
has_exact_synonym |
5-Hydroxytryptophan 5-hydroxytryptophan 2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
5-hydroxy-DL-tryptophan 5-hydroxytryptophan DL-form (+-)-5-hydroxytryptophan DL-5-hydroxytryptophan 5-HTP DL-5-HTP |
|
has_RxCUI |
94 |
|
id |
CHEBI:28171 |
|
in_subset | ||
inchi |
InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16) |
|
inchikey |
LDCYZAJDBXYCGN-UHFFFAOYSA-N |
|
label |
5-Hydroxytryptophan 5-hydroxytryptophan |
|
mass |
220.22466 |
|
monoisotopicmass |
220.08479 |
|
notation |
CHEBI:28171 |
|
prefixIRI |
CHEBI:28171 |
|
prefLabel |
5-Hydroxytryptophan |
|
smiles |
NC(Cc1c[nH]c2ccc(O)cc12)C(O)=O |
|
textual definition |
A tryptophan derivative that is tryptophan substituted by a hydroxy group at position 5. |
|
subClassOf |