loading...| Preferred Name | bromfenac | |
| Synonyms |
bromfenacum 2-amino-3-(4-bromobenzoyl)benzeneacetic acid [2-Amino-3-(4-bromo-benzoyl)-phenyl]-acetic acid bromfenac bromfenaco [2-amino-3-(4-bromobenzoyl)phenyl]acetic acid |
|
| Definitions |
Amfenac in which the the hydrogen at the 4 position of the benzoyl group is substituted by bromine. It is used for the management of ocular pain and treatment of postoperative inflammation in patients who have undergone cataract extraction. It was withdrawn from the US market in 1998, following concerns over off-label abuse and hepatic failure. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_240107 |
|
| alternative term |
bromfenacum 2-amino-3-(4-bromobenzoyl)benzeneacetic acid [2-Amino-3-(4-bromo-benzoyl)-phenyl]-acetic acid bromfenac bromfenaco [2-amino-3-(4-bromobenzoyl)phenyl]acetic acid |
|
| bearer_of | ||
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Bromfenac KEGG:D07541 LINCS:LSM-5585 Drug_Central:401 Beilstein:8335547 Patent:US4683242 DrugBank:DB00963 Patent:EP221753 CAS:91714-94-2 |
|
| formula |
C15H12BrNO3 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
[2-amino-3-(4-bromobenzoyl)phenyl]acetic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
bromfenacum 2-amino-3-(4-bromobenzoyl)benzeneacetic acid [2-Amino-3-(4-bromo-benzoyl)-phenyl]-acetic acid bromfenac bromfenaco |
|
| has_RxCUI |
19737 |
|
| id |
CHEBI:240107 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H12BrNO3/c16-11-6-4-9(5-7-11)15(20)12-3-1-2-10(14(12)17)8-13(18)19/h1-7H,8,17H2,(H,18,19) |
|
| inchikey |
ZBPLOVFIXSTCRZ-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
bromfenac |
|
| mass |
334.16500 |
|
| monoisotopicmass |
333.00006 |
|
| notation |
CHEBI:240107 |
|
| prefixIRI |
CHEBI:240107 |
|
| prefLabel |
bromfenac |
|
| smiles |
Nc1c(CC(O)=O)cccc1C(=O)c1ccc(Br)cc1 |
|
| textual definition |
Amfenac in which the the hydrogen at the 4 position of the benzoyl group is substituted by bromine. It is used for the management of ocular pain and treatment of postoperative inflammation in patients who have undergone cataract extraction. It was withdrawn from the US market in 1998, following concerns over off-label abuse and hepatic failure. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33856 http://purl.obolibrary.org/obo/CHEBI_37141 |