Jump to:
loading...| Preferred Name |
4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|
| Synonyms |
4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|
| Definitions |
A catecholamine in which the aminoethyl side-chain is hydroxy-substituted at C-1 and methylated on nitrogen. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_194548 |
|
| charge |
0 |
|
| formula |
C9H13NO3 |
|
| has_exact_synonym |
4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|
| has_obo_namespace |
chebi_ontology |
|
| id |
CHEBI:194548 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3 |
|
| inchikey |
UCTWMZQNUQWSLP-UHFFFAOYSA-N |
|
| label |
4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|
| mass |
183.207 |
|
| monoisotopicmass |
183.08954 |
|
| notation |
CHEBI:194548 |
|
| prefLabel |
4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|
| smiles |
CNCC(O)C1=CC(O)=C(O)C=C1 |
|
| textual definition |
A catecholamine in which the aminoethyl side-chain is hydroxy-substituted at C-1 and methylated on nitrogen. |
|
| subClassOf |
Create mapping