Preferred Name |
phenylacetate |
|
Synonyms |
phenylacetate 2-phenylethanoate phenylacetic acid anion phenylacetate anion 2-phenylacetate phenylacetate(1-) |
|
Definitions |
A monocarboxylic acid anion that is the conjugate base of phenylacetic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18401 |
|
charge |
-1 |
|
database_cross_reference |
UM-BBD_compID:c0211 MetaCyc:PHENYLACETATE Gmelin:327522 Reaxys:3539899 Beilstein:3539899 |
|
formula |
C8H7O2 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_75772 |
|
has_alternative_id |
CHEBI:25975 CHEBI:14779 |
|
has_exact_synonym |
phenylacetate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-phenylethanoate phenylacetic acid anion phenylacetate anion 2-phenylacetate phenylacetate(1-) |
|
id |
CHEBI:18401 |
|
in_subset | ||
inchi |
InChI=1S/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10)/p-1 |
|
inchikey |
WLJVXDMOQOGPHL-UHFFFAOYSA-M |
|
is conjugate base of | ||
label |
phenylacetate |
|
mass |
135.13998 |
|
monoisotopicmass |
135.04515 |
|
notation |
CHEBI:18401 |
|
prefLabel |
phenylacetate |
|
smiles |
[O-]C(=O)Cc1ccccc1 |
|
textual definition |
A monocarboxylic acid anion that is the conjugate base of phenylacetic acid. |
|
subClassOf |