Preferred Name |
4-hydroxybutyrate |
|
Synonyms |
4-hydroxybutanoate gamma-hydroxybutyrate GHB |
|
Definitions |
A 4-hydroxy monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of 4-hydroxybutyric acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16724 |
|
charge |
-1 |
|
database_cross_reference |
Gmelin:1524032 UM-BBD_compID:c0022 DrugBank:DB01440 KEGG:C00989 Beilstein:3903887 |
|
formula |
C4H7O3 |
|
has functional parent | ||
has role | ||
has_alternative_id |
CHEBI:12006 CHEBI:20401 |
|
has_exact_synonym |
4-hydroxybutanoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4-hydroxybutanoate gamma-hydroxybutyrate GHB |
|
id |
CHEBI:16724 |
|
in_subset | ||
inchi |
InChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7)/p-1 |
|
inchikey |
SJZRECIVHVDYJC-UHFFFAOYSA-M |
|
is conjugate acid of | ||
label |
4-hydroxybutyrate |
|
mass |
103.09658 |
|
monoisotopicmass |
103.04007 |
|
notation |
CHEBI:16724 |
|
prefLabel |
4-hydroxybutyrate |
|
smiles |
OCCCC([O-])=O |
|
textual definition |
A 4-hydroxy monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of 4-hydroxybutyric acid. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_58951 |
Create mapping