loading...| Preferred Name |
potassium carbonate |
|
| Synonyms |
dipotassium carbonate Potassium carbonate, anhydrous Carbonate of potash Carbonic acid, dipotassium salt Kaliumcarbonat K2CO3 |
|
| Definitions |
A potassium salt that is the dipotassium salt of carbonic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_131526 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D02038 Wikipedia:Potassium_carbonate CAS:584-08-7 PMID:26848047 PMID:26638140 PMID:26656574 Reaxys:4267587 PMID:26810599 |
|
| formula |
CK2O3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_33287 |
|
| has_exact_synonym |
dipotassium carbonate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Potassium carbonate, anhydrous Carbonate of potash Carbonic acid, dipotassium salt Kaliumcarbonat K2CO3 |
|
| has_RxCUI |
34300 |
|
| id |
CHEBI:131526 |
|
| in_subset | ||
| inchi |
InChI=1S/CH2O3.2K/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 |
|
| inchikey |
BWHMMNNQKKPAPP-UHFFFAOYSA-L |
|
| label |
potassium carbonate |
|
| mass |
138.206 |
|
| monoisotopicmass |
137.91216 |
|
| notation |
CHEBI:131526 |
|
| prefixIRI |
CHEBI:131526 |
|
| prefLabel |
potassium carbonate |
|
| smiles |
[O-]C([O-])=O.[K+].[K+] |
|
| textual definition |
A potassium salt that is the dipotassium salt of carbonic acid. |
|
| subClassOf |