Preferred Name |
benzocaine |
|
Synonyms |
p-Ethoxycarboxylic aniline Ethyl p-aminobenzoate Benzocainum Ethyl aminobenzoate Ethyl p-aminophenylcarboxylate p-Carbethoxyaniline p-(Ethoxycarbonyl)aniline 4-aminobenzoic acid ethyl ester Amben ethyl ester Benzocaina Benzocaine ethyl 4-aminobenzoate |
|
Definitions |
A benzoate ester having 4-aminobenzoic acid as the acid component and ethanol as the alcohol component. A surface anaesthetic, it is used to suppress the gag reflex, and as a lubricant and topical anaesthetic on the larynx, mouth, nasal cavity, respiratory tract, oesophagus, rectum, urinary tract, and vagina. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_116735 |
|
alternative term |
p-Ethoxycarboxylic aniline Ethyl p-aminobenzoate Benzocainum Ethyl aminobenzoate Ethyl p-aminophenylcarboxylate p-Carbethoxyaniline p-(Ethoxycarbonyl)aniline 4-aminobenzoic acid ethyl ester Amben ethyl ester Benzocaina Benzocaine ethyl 4-aminobenzoate |
|
bearer_of |
http://purl.obolibrary.org/obo/CHEBI_50904 http://purl.obolibrary.org/obo/CHEBI_48425 |
|
charge |
0 |
|
database_cross_reference |
PMID:21616561 PMID:1155304 HMDB:HMDB0004992 Drug_Central:323 PMID:22105694 PMID:16640711 PMID:23301559 KEGG:D00552 DrugBank:DB01086 PMID:18971079 KEGG:C07527 PMID:29079364 PMID:23565580 Reaxys:638434 Beilstein:638434 PMID:22015737 PMID:2579237 LINCS:LSM-5830 PMID:12574744 PMID:25097477 PMID:12873507 PMID:10866370 PMID:23696166 PMID:22556388 PMID:22551703 Wikipedia:Benzocaine CAS:94-09-7 |
|
formula |
C9H11NO2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50904 http://purl.obolibrary.org/obo/CHEBI_48425 |
|
has_alternative_id |
CHEBI:3030 |
|
has_exact_synonym |
ethyl 4-aminobenzoate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
p-Ethoxycarboxylic aniline Ethyl p-aminobenzoate Benzocainum Ethyl aminobenzoate Ethyl p-aminophenylcarboxylate p-Carbethoxyaniline p-(Ethoxycarbonyl)aniline 4-aminobenzoic acid ethyl ester Amben ethyl ester Benzocaina Benzocaine |
|
has_RxCUI |
1399 |
|
id |
CHEBI:116735 |
|
in_subset | ||
inchi |
InChI=1S/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
|
inchikey |
BLFLLBZGZJTVJG-UHFFFAOYSA-N |
|
label |
Benzocaine benzocaine |
|
mass |
165.18910 |
|
monoisotopicmass |
165.07898 |
|
notation |
CHEBI:116735 |
|
prefixIRI |
CHEBI:116735 |
|
prefLabel |
benzocaine |
|
smiles |
CCOC(=O)c1ccc(N)cc1 |
|
textual definition |
A benzoate ester having 4-aminobenzoic acid as the acid component and ethanol as the alcohol component. A surface anaesthetic, it is used to suppress the gag reflex, and as a lubricant and topical anaesthetic on the larynx, mouth, nasal cavity, respiratory tract, oesophagus, rectum, urinary tract, and vagina. |
|
subClassOf |