loading...| Preferred Name | ADP(3-) | |
| Synonyms |
5'-O-[(phosphonatooxy)phosphinato]adenosine ADP trianion ADP adenosine 5'-diphosphate |
|
| Definitions |
A nucleoside 5'-diphosphate(3-) arising from deprotonation of all three diphosphate OH groups of adenosine 5'-diphosphate (ADP); major species present at pH 7.3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_456216 |
|
| charge |
-3 |
|
| database_cross_reference |
Gmelin:341336 Beilstein:3783669 |
|
| definition |
A nucleoside 5'-diphosphate(3-) arising from deprotonation of all three diphosphate OH groups of adenosine 5'-diphosphate (ADP); major species present at pH 7.3. |
|
| formula |
C10H12N5O10P2 |
|
| has characteristic | ||
| has role | ||
| has_exact_synonym |
adenosine 5'-diphosphate |
|
| has_related_synonym |
5'-O-[(phosphonatooxy)phosphinato]adenosine ADP trianion ADP |
|
| hasOBONamespace |
chebi_ontology |
|
| id |
CHEBI:456216 |
|
| inchi |
InChI=1S/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-27(21,22)25-26(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H2,11,12,13)(H2,18,19,20)/p-3/t4-,6-,7-,10-/m1/s1 |
|
| inchikey |
XTWYTFMLZFPYCI-KQYNXXCUSA-K |
|
| inSubset | ||
| is_conjugate_base_of | ||
| label |
ADP(3-) |
|
| mass |
424.17730 |
|
| monoisotopicmass |
424.00759 |
|
| notation |
CHEBI:456216 |
|
| prefLabel |
ADP(3-) |
|
| smiles |
Nc1ncnc2n(cnc12)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])([O-])=O)[C@@H](O)[C@H]1O |
|
| subClassOf |