Jump to:
loading...| Preferred Name | serine | |
| Synonyms |
2-Amino-3-hydroxypropionic acid 3-Hydroxyalanine 2-amino-3-hydroxypropanoic acid Serin Serine serine |
|
| Definitions |
An alpha-amino acid that is alanine substituted at position 3 by a hydroxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17822 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1721402 Wikipedia:Serine KEGG:C00716 Gmelin:26429 CAS:302-84-1 KNApSAcK:C00001393 Reaxys:1721402 |
|
| definition |
An alpha-amino acid that is alanine substituted at position 3 by a hydroxy group. |
|
| formula |
C3H7NO3 |
|
| has characteristic | ||
| has part | ||
| has role | ||
| has_exact_synonym |
Serine serine |
|
| has_related_synonym |
2-Amino-3-hydroxypropionic acid 3-Hydroxyalanine 2-amino-3-hydroxypropanoic acid Serin |
|
| hasAlternativeId |
CHEBI:15081 CHEBI:26648 CHEBI:9116 |
|
| hasOBONamespace |
chebi_ontology |
|
| id |
CHEBI:17822 |
|
| inchi |
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) |
|
| inchikey |
MTCFGRXMJLQNBG-UHFFFAOYSA-N |
|
| inSubset | ||
| is_conjugate_acid_of | ||
| is_conjugate_base_of | ||
| is_tautomer_of | ||
| label |
serine |
|
| mass |
105.09262 |
|
| monoisotopicmass |
105.04259 |
|
| notation |
CHEBI:17822 |
|
| overlaps | ||
| prefLabel |
serine |
|
| smiles |
NC(CO)C(O)=O |
|
| subClassOf |
Create mapping