loading...| Preferred Name |
exemestane |
|
| Synonyms |
6-methyleneandrosta-1,4-diene-3,17-dione C20H24O2 exemestane exemestanum [H][C@@]12CC(=C)C3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] exemestano InChIKey=BFYIZQONLCFLEV-DAELLWKTSA-N InChI=1S/C20H24O2/c1-12-10-14-15-4-5-18(22)20(15,3)9-7-16(14)19(2)8-6-13(21)11-17(12)19/h6,8,11,14-16H,1,4-5,7,9-10H2,2-3H3/t14-,15-,16-,19+,20-/m0/s1 Exemestane 6-methylideneandrosta-1,4-diene-3,17-dione |
|
| Definitions |
Androsta-1,4-diene-3,17-dione in which the hydrogens at position 6 are replaced by a double bond to a methylene group.a selective inhibitor of the aromatase (oestrogen synthase) system, it is used in the treatment of advanced breast cancer. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4953 |
|
| database_cross_reference |
Wikipedia:Exemestane CiteXplore:10882163 KEGG COMPOUND:C08162 KEGG DRUG:D00963 KEGG COMPOUND:107868-30-4 DrugBank:DB00990 ChemIDplus:107868-30-4 |
|
| definition |
Androsta-1,4-diene-3,17-dione in which the hydrogens at position 6 are replaced by a double bond to a methylene group.a selective inhibitor of the aromatase (oestrogen synthase) system, it is used in the treatment of advanced breast cancer. |
|
| has_exact_synonym |
Exemestane 6-methylideneandrosta-1,4-diene-3,17-dione |
|
| has_related_synonym |
6-methyleneandrosta-1,4-diene-3,17-dione C20H24O2 exemestane exemestanum [H][C@@]12CC(=C)C3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] exemestano InChIKey=BFYIZQONLCFLEV-DAELLWKTSA-N InChI=1S/C20H24O2/c1-12-10-14-15-4-5-18(22)20(15,3)9-7-16(14)19(2)8-6-13(21)11-17(12)19/h6,8,11,14-16H,1,4-5,7,9-10H2,2-3H3/t14-,15-,16-,19+,20-/m0/s1 |
|
| has_RxCUI |
258494 |
|
| id |
CHEBI:4953 |
|
| imported from | ||
| label |
exemestane |
|
| notation |
CHEBI:4953 |
|
| prefLabel |
exemestane |
|
| subClassOf |