Preferred Name |
Propofol |
|
Synonyms |
InChI=1S/C12H18O/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9,13H,1-4H3 Disoprivan 2,6-bis(1-methylethyl)phenol 2,6-Diisopropylphenol C12H18O InChIKey=OLBCVFGFOZPWHH-UHFFFAOYSA-N propofol Disoprofol propofolum CC(C)c1cccc(C(C)C)c1O Diprivan 2,6-BIS(1-METHYLETHYL)PHENOL Rapinovet 2,6-bis(propan-2-yl)phenol Propofol |
|
Definitions |
A phenol resulting from the formal substitution of the hydrogen at the 2 position of 1,3-diisopropylbenzene by a hydroxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_44915 |
|
database_cross_reference |
ChemIDplus:2078-54-8 PDBeChem:PFL KEGG COMPOUND:C07523 DrugBank:DB00818 ChemIDplus:1866484 NIST Chemistry WebBook:2078-54-8 KEGG COMPOUND:2078-54-8 KEGG DRUG:D00549 Wikipedia:Propofol |
|
definition |
A phenol resulting from the formal substitution of the hydrogen at the 2 position of 1,3-diisopropylbenzene by a hydroxy group. |
|
has_alternative_id |
CHEBI:8495 CHEBI:44914 |
|
has_exact_synonym |
2,6-bis(propan-2-yl)phenol Propofol |
|
has_related_synonym |
InChI=1S/C12H18O/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9,13H,1-4H3 Disoprivan 2,6-bis(1-methylethyl)phenol 2,6-Diisopropylphenol C12H18O InChIKey=OLBCVFGFOZPWHH-UHFFFAOYSA-N propofol Disoprofol propofolum CC(C)c1cccc(C(C)C)c1O Diprivan 2,6-BIS(1-METHYLETHYL)PHENOL Rapinovet |
|
has_RxCUI |
8782 |
|
id |
CHEBI:44915 |
|
imported from | ||
label |
Propofol propofol |
|
notation |
CHEBI:44915 |
|
prefLabel |
Propofol |
|
subClassOf |