loading...| Preferred Name | Amantadine | |
| Synonyms |
1-adamantylamine InChI=1S/C10H17N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6,11H2 amantadinum 1-aminoadamantane amantadina Virosol amantadine tricyclo[3.3.1.1(3,7)]decane-1-amine tricyclo[3.3.1.1(3,7)]decan-1-ylamine Viregyt tricyclo[3.3.1.1(3,7)]decan-1-amine InChIKey=DKNWSYNQZKUICI-UHFFFAOYSA-N Amantidine 1-adamantanamine NC12CC3CC(CC(C3)C1)C2 C10H17N Aminoadamantane Amantadine adamantan-1-ylamine |
|
| Definitions |
An adamantane that has formula C10H17N. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2618 |
|
| database_cross_reference |
DrugBank:DB00915 KEGG DRUG:D07441 Wikipedia:Amantadine KEGG COMPOUND:768-94-5 Beilstein:2204333 ChemIDplus:768-94-5 Gmelin:27066 NIST Chemistry WebBook:768-94-5 KEGG COMPOUND:C06818 |
|
| definition |
An adamantane that has formula C10H17N. |
|
| has_exact_synonym |
Amantadine adamantan-1-ylamine |
|
| has_related_synonym |
1-adamantylamine InChI=1S/C10H17N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6,11H2 amantadinum 1-aminoadamantane amantadina Virosol amantadine tricyclo[3.3.1.1(3,7)]decane-1-amine tricyclo[3.3.1.1(3,7)]decan-1-ylamine Viregyt tricyclo[3.3.1.1(3,7)]decan-1-amine InChIKey=DKNWSYNQZKUICI-UHFFFAOYSA-N Amantidine 1-adamantanamine NC12CC3CC(CC(C3)C1)C2 C10H17N Aminoadamantane |
|
| has_RxCUI |
620 |
|
| id |
CHEBI:2618 |
|
| imported from | ||
| label |
Amantadine amantadine |
|
| notation |
CHEBI:2618 |
|
| prefLabel |
Amantadine |
|
| subClassOf |