loading...| Preferred Name |
hexadecanoate |
|
| Synonyms |
hexadecanoate InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/p-1 n-hexadecanoate CH3-[CH2]14-COO(-) CCCCCCCCCCCCCCCC([O-])=O 1-pentadecanecarboxylate pentadecanecarboxylate 1-hexyldecanoate Hexadecanoic acid, ion(1-) 255.41610 n-hexadecoate palmitate C16H31O2 (16:0) IPCSVZSSVZVIGE-UHFFFAOYSA-M |
|
| Definitions |
A long-chain fatty acid anion that is the conjugate base of hexadecanoic acid (palmitic acid); major species at pH 7.3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7896 |
|
| database_cross_reference |
CAS:143-20-4 Reaxys:3589907 Beilstein:3589907 Gmelin:344266 MetaCyc:PALMITATE HMDB:HMDB00220 |
|
| definition |
A long-chain fatty acid anion that is the conjugate base of hexadecanoic acid (palmitic acid); major species at pH 7.3. |
|
| has role | ||
| has_alternative_id |
CHEBI:231736 |
|
| has_exact_synonym |
hexadecanoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/p-1 n-hexadecanoate CH3-[CH2]14-COO(-) CCCCCCCCCCCCCCCC([O-])=O 1-pentadecanecarboxylate pentadecanecarboxylate 1-hexyldecanoate Hexadecanoic acid, ion(1-) 255.41610 n-hexadecoate palmitate C16H31O2 (16:0) IPCSVZSSVZVIGE-UHFFFAOYSA-M |
|
| id |
CHEBI:7896 |
|
| imported from | ||
| is conjugate base of | ||
| label |
hexadecanoate |
|
| notation |
CHEBI:7896 |
|
| prefLabel |
hexadecanoate |
|
| subClassOf |