Preferred Name | dibutyl phthalate | |
Synonyms |
Benzenedicarboxylic acid dibutyl ester Di-n-butyl phthalate 278.34350 DBP 1,2-Benzenedicarboxylic acid dibutyl ester Phthalic acid dibutyl ester CCCCOC(=O)c1ccccc1C(=O)OCCCC C16H22O4 DOIRQSBPFJWKBE-UHFFFAOYSA-N Phthalic acid di-n-butyl ester InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 Butyl phthalate Dibutyl o-phthalate o-Benzenedicarboxylic acid dibutyl ester n-Butyl phthalate Dibutyl-o-phthalate Benzene-o-dicarboxylic acid di-n-butyl ester Dibutyl 1,2-benzenedicarboxylate Dibutyl phthalate dibutyl benzene-1,2-dicarboxylate |
|
Definitions |
A phthalate ester that is the diester obtained by the formal condensation of the carboxy groups of phthalic acid with two molecules of butan-1-ol. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_34687 |
|
database_cross_reference |
KEGG:C14214 PMID:24468924 Wikipedia:Dibutyl_phthalate PMID:19840837 PMID:11133400 HMDB:HMDB33244 PMID:24616073 Gmelin:262569 PMID:24213843 Reaxys:1914064 CAS:84-74-2 Beilstein:1914064 |
|
definition |
A phthalate ester that is the diester obtained by the formal condensation of the carboxy groups of phthalic acid with two molecules of butan-1-ol. |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_50905 http://purl.obolibrary.org/obo/CHEBI_79056 |
|
has_alternative_id |
CHEBI:535597 |
|
has_exact_synonym |
Dibutyl phthalate dibutyl benzene-1,2-dicarboxylate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Benzenedicarboxylic acid dibutyl ester Di-n-butyl phthalate 278.34350 DBP 1,2-Benzenedicarboxylic acid dibutyl ester Phthalic acid dibutyl ester CCCCOC(=O)c1ccccc1C(=O)OCCCC C16H22O4 DOIRQSBPFJWKBE-UHFFFAOYSA-N Phthalic acid di-n-butyl ester InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 Butyl phthalate Dibutyl o-phthalate o-Benzenedicarboxylic acid dibutyl ester n-Butyl phthalate Dibutyl-o-phthalate Benzene-o-dicarboxylic acid di-n-butyl ester Dibutyl 1,2-benzenedicarboxylate |
|
id |
CHEBI:34687 |
|
imported from | ||
label |
dibutyl phthalate |
|
notation |
CHEBI:34687 |
|
prefLabel |
dibutyl phthalate |
|
subClassOf |